
CAS Number65259-81-6
Synonyms(2R,3R)-2,3-Bis[(2,2-dimethylpropanoyl)oxy]succinic acid; (-)-dipivaloyl-l-tartaric acid; DIPIVALOYL-L-TARTARIC ACID; (2S,3S)-2,3-Bis[(2,2-dimethylpropanoyl)oxy]succinic acid; MFCD00066535; DIPIVALOYL-D-TARTARIC ACID
Molecular FormulaHO2CCH(OH)CH(OH)CO2H
Molecular Weight150.09
Purity≥99.5%
Density1.2±0.1 g/cm3
Boiling Point436.6±45.0 °C at 760 mmHg
Melting Point170-172 °C (lit.)
Appearancecrystalline powder
EINECS201-766-0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 65259-81-6 |
| Catalog No. | 2A-1196058 |
| Chinese Name | (-)-二特戊酰基-L-酒石酸 |
| Synonyms | (2R,3R)-2,3-Bis[(2,2-dimethylpropanoyl)oxy]succinic acid; (-)-dipivaloyl-l-tartaric acid; DIPIVALOYL-L-TARTARIC ACID; (2S,3S)-2,3-Bis[(2,2-dimethylpropanoyl)oxy]succinic acid; MFCD00066535; DIPIVALOYL-D-TARTARIC ACID |
| Molecular Formula | HO2CCH(OH)CH(OH)CO2H |
| Molecular Weight | 150.09 |
| Purity | ≥99.5 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 436.6±45.0 °C at 760 mmHg |
| Melting Point | 170-172 °C (lit.) |
| Appearance | crystalline powder |
| Storage Condition | Store in a sealed container filled with inert gas |
| EINECS | 201-766-0 |
| HTC | 2918990090 |
| PubChem ID | 24855129 |
| MDL Number | MFCD00064207 |
| SMILES | O[C@H]([C@@H](O)C(O)=O)C(O)=O |
| InChI | 1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/t1-,2-/m1/s1 |
| InChI Key | FEWJPZIEWOKRBE-JCYAYHJZSA-N |
| Beilstein/REAXYS | 1725147 |
| NACRES Code | NA.21 |
| UNSPSC | 12352100 |
| MSDS | msds/197797_1_65259_81_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-aMino-5-hydroxy-4-Methoxybenzoic acid | 31839-21-1 | 2A-1196051 |
| 1-Bromo-4-[(1E)-2-(4-methylphenyl)ethenyl]benzene | 58358-52-4 | 2A-1196052 |
| Atituzole hydrochloride | 2A-2196053 | 2A-2196053 |
| methyl 2-mercaptonicotinate | 1431964-96-3 | 2A-1196056 |
| 5-BroMo-4-Methylnicotinic acid | 677702-58-8 | 2A-1196057 |
| Valine | 7004-03-7 | 2A-2196059 |
| Branched chain amino acid | 2A-2196061 | 2A-2196061 |
| Elastomeric polyether | 2A-2196068 | 2A-2196068 |
| Polyurethane catalyst | 2A-2196069 | 2A-2196069 |
| PU FOAM | 2A-2196070 | 2A-2196070 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA