CAS Number3943-80-4
SynonymsEthyl 3,5-dimethoxy-4-hydroxybenzoate; 4-Hydroxy-3,5-dimethoxy-benzoesaeure-aethylester; Benzoic acid, 4-hydroxy-3,5-dimethoxy-, ethyl ester; Ester etylowy kwasu syringowego [Polish]; Ethyl 4-hydroxy-3,5-dimethoxybenzoate; 4-Oxy-3.5-dimethoxy-benzoesaeureaethylester; 4-hydroxy-3,5-dimethoxy-benzoic acid ethyl ester; Ethyl syringate; BENZOIC ACID,3,5-DIMETHOXY-4-HYDROXY-,ETHYL ESTER; syringic acid ethyl ester; 3,5-Dimethoxy-4-hydroxybenzoic acid ethyl ester; 3.5-Dimethylaether-gallussaeure-aethylester
Molecular FormulaC11H14O5
Molecular Weight226.23
Density1.2±0.1 g/cm3
Boiling Point352.5±37.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3943-80-4 |
| Catalog No. | 2A-2195922 |
| Chinese Name | 丁香酸乙酯 |
| Synonyms | Ethyl 3,5-dimethoxy-4-hydroxybenzoate; 4-Hydroxy-3,5-dimethoxy-benzoesaeure-aethylester; Benzoic acid, 4-hydroxy-3,5-dimethoxy-, ethyl ester; Ester etylowy kwasu syringowego [Polish]; Ethyl 4-hydroxy-3,5-dimethoxybenzoate; 4-Oxy-3.5-dimethoxy-benzoesaeureaethylester; 4-hydroxy-3,5-dimethoxy-benzoic acid ethyl ester; Ethyl syringate; BENZOIC ACID,3,5-DIMETHOXY-4-HYDROXY-,ETHYL ESTER; syringic acid ethyl ester; 3,5-Dimethoxy-4-hydroxybenzoic acid ethyl ester; 3.5-Dimethylaether-gallussaeure-aethylester |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 352.5±37.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2918990090 |
| PubChem ID | 8164700 |
| MDL Number | MFCD01661203 |
| SMILES | CCOC(=O)c1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C11H14O5/c1-4-16-11(13)7-5-8(14-2)10(12)9(6-7)15-3/h5-6,12H,4H2,1-3H3 |
| InChI Key | WKUVKFZZCHINKG-UHFFFAOYSA-N |
| MSDS | msds/197651_1_3943_80_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,2-bis(2-bromophenyl)benzene | 98470-26-9 | 2A-1195909 |
| trimethyl 2,2',2''-nitrilotribenzoate | 34069-90-4 | 2A-1195910 |
| H-SAR-OBZL HCL | 40298-32-6 | 2A-1195912 |
| Di-tert-butylamine | 21981-37-3 | 2A-1195913 |
| Penehyclidine HCl (Mixture of IsoMers) | 151937-76-7 | 2A-1195916 |
| METHYL (3S)-3-AMINO-3-PHENYLPROPANOATE | 37088-66-7 | 2A-2195927 |
| 1,3-dimethyl-butylamine citrate | 1398123-75-5 | 2A-2195929 |
| Hawthorn Leaf fruit Powder Extract flavone | 2A-2195931 | 2A-2195931 |
| Garcinia Cambogia Extract Hydroxycitric Acid | 2A-2195934 | 2A-2195934 |
| CITRUS AURANTIUM EXTRACT | 2A-2195935 | 2A-2195935 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS