
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 76376-43-7 |
| Catalog No. | 2A-1195691 |
| Chinese Name | 大戟因子L1 |
| Synonyms | EUPATOROXIN,10-EPI; Euphorbia Factor L1; 10-epi-Eupatoroxin |
| Molecular Formula | C32H40O8 |
| Molecular Weight | 552.66 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 633.1±55.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| Application | Euphorbia Factor L1 is a diterpenoid compound in Euphorbia, which can reduce the protein and mRNA levels of Bcl-2, PI3K, AKT and mTOR, and increase the protein levels of caspase-9 and caspase-3, but h |
| PubChem ID | 274952958 |
| MDL Number | C32H40O8 |
| SMILES | CC(=O)OC1C2C(OC(=O)Cc3ccccc3)C(C)CC2(OC(C)=O)C(=O)C(C)=CC2C(CCC13CO3)C2(C)C |
| InChI | InChI=1S/C32H40O8/c1-18-14-24-23(30(24,5)6)12-13-31(17-37-31)29(38-20(3)33)26-27(39-25(35)15-22-10-8-7-9-11-22)19(2)16-32(26,28(18)36)40-21(4)34/h7-11,14,19,23-24,26-27,29H,12-13,15-17H2,1-6H3/b18-14-/t19-,23-,24+,26+,27-,29-,31+,32+/m0/s1 |
| InChI Key | SDGDWRYYHQOQOJ-JGTACXIJSA-N |
| MSDS | msds/197411_1_76376_43_7.pdf |
| Transport Info | Product name: Euphorbia factor L1 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Arachis hypogaea Linn. | 2A-2195679 | 2A-2195679 |
| Oryza latifolia Desv. | 2A-2195680 | 2A-2195680 |
| Triticum aestivum L. | 2A-2195681 | 2A-2195681 |
| 2,6-diMethyl-4-hydroxybenzoic acid Methyl ester | 83194-70-1 | 2A-2195685 |
| talatisamine | 20501-56-8 | 2A-1195690 |
| Norgesterone | 13563-60-5 | 2A-2195692 |
| 3-Amino-2,2-difluoropropanoic acid hydrochloride | 1159825-06-5 | 2A-1195698 |
| N,N,N',N'-TETRAMETHYL-O-PHENYLENEDIAMINE | 704-01-8 | 2A-1195699 |
| METHYL-(2-PIPERIDIN-1-YL-ETHYL)-AMINE | 41239-39-8 | 2A-1195700 |
| 5-Chloro-3-methylbenzoxazol-2(3H)-one | 5790-90-9 | 2A-2195706 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA