
CAS Number2350-46-1
Synonyms2,3-dichloro-4-butyroylphenol; 4-Butyryl-2,3-dichlorophenol; 2',3'-Dichlor-4'-hydroxybutyrophenon; 1-Butanone,1-(2,3-dichloro-4-hydroxyphenyl); 2,3-dichloro-4-butyrylphenol; 2.3-Dichlor-4-butyryl-phenol; 2',3'-dichloro-4'-hydroxybutyrophenone
Molecular FormulaC18H18O3
Molecular Weight282.342
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2350-46-1 |
| Catalog No. | 2A-2195550 |
| Chinese Name | 1-(2,3-dichloro-4-hydroxyphenyl)butan-1-one |
| Synonyms | 2,3-dichloro-4-butyroylphenol; 4-Butyryl-2,3-dichlorophenol; 2',3'-Dichlor-4'-hydroxybutyrophenon; 1-Butanone,1-(2,3-dichloro-4-hydroxyphenyl); 2,3-dichloro-4-butyrylphenol; 2.3-Dichlor-4-butyryl-phenol; 2',3'-dichloro-4'-hydroxybutyrophenone |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.342 |
| HTC | 2914700090 |
| PubChem ID | 33146859 |
| MDL Number | MFCD01333469 |
| SMILES | CCCC(=O)c1ccc(O)c(Cl)c1Cl |
| InChI | InChI=1S/C10H10Cl2O2/c1-2-3-7(13)6-4-5-8(14)10(12)9(6)11/h4-5,14H,2-3H2,1H3 |
| InChI Key | MRAKITVQDPSLMI-UHFFFAOYSA-N |
| MSDS | msds/197257_1_2350_46_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| LVME | 2A-2195545 | 2A-2195545 |
| Catochol | 2A-2195546 | 2A-2195546 |
| Isonipecotic Acide,98% | 2A-2195547 | 2A-2195547 |
| GE Sample | 2A-2195548 | 2A-2195548 |
| GPH(W) | 2A-2195549 | 2A-2195549 |
| bis (trimethy amin) Trifuoro | 2A-2195551 | 2A-2195551 |
| TNBT (om titanates) 155 | 2A-2195552 | 2A-2195552 |
| TIPT 156 | 2A-2195553 | 2A-2195553 |
| 3-HYDROXY BENZALDIHYDE | 2A-2195554 | 2A-2195554 |
| Hydroxycarbamic acid phenyl ester | 38064-07-2 | 2A-2195555 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA