
CAS Number1984-58-3
Synonyms2.5-Dichlor-1-methoxy-benzol; Anisole,2,5-dichloro; Benzene,1,4-dichloro-2-methoxy; MFCD00061123; EINECS 217-852-6; 2,5-Dichloroanisole; 2,5-Dichloromethoxybenzene; 2,5-Dichlor-anisol; 1,4-dichloro-2-methoxy-benzene; 2,4-DICHLOROTHIAZOLE-5-CARBOXALDEHYDE
Molecular FormulaC7H6Cl2O
Molecular Weight177.02800
Purity98%
Density1.289 g/cm3
Boiling Point218.5ºC at 760 mmHg
Melting Point24ºC
AppearanceColorless to light yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1984-58-3 |
| Catalog No. | 2A-9001971 |
| Chinese Name | 2,5-二氯苯甲醚 |
| Synonyms | 2.5-Dichlor-1-methoxy-benzol; Anisole,2,5-dichloro; Benzene,1,4-dichloro-2-methoxy; MFCD00061123; EINECS 217-852-6; 2,5-Dichloroanisole; 2,5-Dichloromethoxybenzene; 2,5-Dichlor-anisol; 1,4-dichloro-2-methoxy-benzene; 2,4-DICHLOROTHIAZOLE-5-CARBOXALDEHYDE |
| Molecular Formula | C7H6Cl2O |
| Molecular Weight | 177.02800 |
| Purity | 98 |
| Density | 1.289 g/cm3 |
| Boiling Point | 218.5ºC at 760 mmHg |
| Melting Point | 24ºC |
| Appearance | Colorless to light yellow liquid |
| Storage Condition | Sealed, stored at 2ºC -8ºC |
| HTC | 2909309090 |
| SMILES | COc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C7H6Cl2O/c1-10-7-4-5(8)2-3-6(7)9/h2-4H,1H3 |
| InChI Key | QKMNFFSBZRGHDJ-UHFFFAOYSA-N |
| MSDS | msds/1971_1_1984_58_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,5-Diaminobenzotrifluoride | 364-13-6 | 2A-9001960 |
| 2,5-Dibromoaniline | 3638-73-1 | 2A-9001963 |
| 2,5-Dibromobenzenesulphonyl chloride | 23886-64-8 | 2A-9001964 |
| 2,5-Dibromobenzotrifluoride | 7657-09-2 | 2A-9001965 |
| 2',5'-Dichloroacetophenone | 2476-37-1 | 2A-9001970 |
| 2,5-Dichlorobenzonitrile | 21663-61-6 | 2A-9001973 |
| 2,5-Dichlorobenzoyl chloride | 2905-61-5 | 2A-9001974 |
| 2,5-Dichlorofluorobenzene | 348-59-4 | 2A-9001975 |
| 2,5-Dichloronicotinic acid | 59782-85-3 | 2A-9001976 |
| 2,5-Dichlorothiophenol | 5858-18-4 | 2A-9001980 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA