![3-[(2,4-Dimethylpyrrol-5-yl)methylidenyl]-2-indolinon structure, CAS 194413-58-6](/structures/210000/197080_1_194413_58_6.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 194413-58-6 |
| Catalog No. | 2A-2195383 |
| Chinese Name | Semaxanib |
| Synonyms | CK 1752A; Sematilide HCl; Sematilide monohydrochloride; SEMATILIDE HYDROCHLORIDE; Semaxanib (SU5416) |
| Molecular Formula | C15H14O1N2 |
| Molecular Weight | 238.29 |
| Density | 1.256g/cm3 |
| Boiling Point | 481.4ºC at 760mmHg |
| Melting Point | 220-222℃ |
| Appearance | powder |
| Storage Condition | -20℃ |
| Application | (Z)-Semaxanib (compound (Z)-1) is a potent tyrosine kinase inhibitor. (Z)-Semaxanib is cytotoxic to TAMH and HepG2 cells with IC50s of 6.28µM and 8.17µM respectively [1]. |
| PubChem ID | 525180 |
| MDL Number | MFCD09763655 |
| SMILES | Cc1cc(C)c(C=C2C(=O)Nc3ccccc32)[nH]1 |
| InChI | InChI=1S/C15H14N2O/c1-9-7-10(2)16-14(9)8-12-11-5-3-4-6-13(11)17-15(12)18/h3-8,16H,1-2H3,(H,17,18)/b12-8- |
| InChI Key | WUWDLXZGHZSWQZ-WQLSENKSSA-N |
| MSDS | msds/197080_1_194413_58_6.pdf |
| Transport Info | Product name: Semaxanib (SU5416) |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 3,6-Dibromo-benzene-1,2,4,5-tetracarbonitrile | 60510-13-6 | 2A-1194905 |
| Tris[1-(2,4-diisopropyldibenzo[b,d]furan-3-yl)-2-phenyl-1H-iMidazole] iridiuM(III) | 1331833-06-7 | 2A-1194931 |
| 3-(((Benzyloxy)carbonyl)amino)-4-(2,4,5-trifluorophenyl)butanoic Acid | 1246960-25-7 | 2A-1195124 |
| Benzenepropanoic acid, α-[(dimethylamino)methylene]-2,4,5-trifluoro-3-methoxy-β-oxo-, ethyl ester, (αZ)- | 1363407-28-6 | 2A-1195220 |
| N1-(2,4-DIMETHOXYBENZYL)-N2-(2-PYRIDIN-2-YL)ETHYL)OXALAMIDE | 745047-53-4 | 2A-1195257 |
| 1,3-DiMethyl-2,4-dioxo-1,2,3,4-tetrahydropyriMidine-5-carboxylic Acid | 4869-45-8 | 2A-2195397 |
| 5-Amino-2,4-ditert-butylphenol HCL | 1777786-05-6 | 2A-1195404 |
| methyl 5-(2,4-difluorophenyl)-4-methoxy-1H-pyrrole-3-carboxylate | 1902955-29-6 | 2A-2195429 |
| α-Tosyl-(2,4-difluorobenzyl)isocyanide | 660431-66-3 | 2A-2195430 |
| 2,4-difluoro phenyl magnesium bromide | 144025-04-7 | 2A-2195525 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA