![[[p-(2-methoxyethyl)phenoxy]methyl]oxirane structure, CAS 56718-70-8](/structures/210000/196987_1_56718_70_8.png)
CAS Number56718-70-8
Synonyms1-(2,3-epoxypropoxy)-4-(2-methoxyethyl)-benzene; ((p-(2-Methoxyethyl)phenoxy)methyl)oxirane; 1-(2-Methoxyethyl)-4-(oxiranylmethoxy)benzene; 1-[p-(2-methoxyethyl)-phenoxy]-2,3-epoxy-propane; 3-[4-(2-Methoxyethyl)phenoxy]-1,2-propenoxide; 4-(2,3-epoxypropoxy)-(2-methoxyethyl)-benzene; 1-[4-(2-methoxyethyl)phenoxy]-2,3-epoxypropane; 1,2-epoxy-3-[4-(2-methoxyethyl)phenoxy]propane; 2-{[4-(2-Methoxyethyl)phenoxy]methyl}oxirane; Oxirane,[[4-(2-methoxyethyl)phenoxy]methyl]-,(S); EINECS 260-353-3
Molecular FormulaC12H16O3
Molecular Weight208.26
Density1.099g/cm3
Boiling Point300.6ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 56718-70-8 |
| Catalog No. | 2A-2195294 |
| Chinese Name | 3-[4-(2-甲氧基乙基)苯氧基]-1,2-环氧丙烷 |
| Synonyms | 1-(2,3-epoxypropoxy)-4-(2-methoxyethyl)-benzene; ((p-(2-Methoxyethyl)phenoxy)methyl)oxirane; 1-(2-Methoxyethyl)-4-(oxiranylmethoxy)benzene; 1-[p-(2-methoxyethyl)-phenoxy]-2,3-epoxy-propane; 3-[4-(2-Methoxyethyl)phenoxy]-1,2-propenoxide; 4-(2,3-epoxypropoxy)-(2-methoxyethyl)-benzene; 1-[4-(2-methoxyethyl)phenoxy]-2,3-epoxypropane; 1,2-epoxy-3-[4-(2-methoxyethyl)phenoxy]propane; 2-{[4-(2-Methoxyethyl)phenoxy]methyl}oxirane; Oxirane,[[4-(2-methoxyethyl)phenoxy]methyl]-,(S); EINECS 260-353-3 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 |
| Density | 1.099g/cm3 |
| Boiling Point | 300.6ºC at 760 mmHg |
| Storage Condition | -20℃ |
| HTC | 2910900090 |
| PubChem ID | 10225447 |
| MDL Number | MFCD00799225 |
| SMILES | COCCc1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C12H16O3/c1-13-7-6-10-2-4-11(5-3-10)14-8-12-9-15-12/h2-5,12H,6-9H2,1H3 |
| InChI Key | UEOWFGJMGUIGHC-UHFFFAOYSA-N |
| MSDS | msds/196987_1_56718_70_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2910900090. epoxides, epoxyalcohols, epoxyphenols and epoxyethers, with a three-membered ring, and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 6,7-Dihydrothieno[3,2-C]-pyridine | 107112-93-6 | 2A-1195235 |
| 7-bromo-4-methyl-5-nitro-1H-indazole | 952183-46-9 | 2A-1195238 |
| 3-(3-methylphenyl)piperidine(SALTDATA: HCl) | 343856-70-2 | 2A-1195245 |
| 2-BroMo-5-cyclopropylpyrazine | 1086382-78-6 | 2A-1195252 |
| 2-CHLOROPYRIMIDINE-4-CARBALDEHYDE | 944901-22-8 | 2A-1195261 |
| 5-Methyl-2-phenoxypyridine | 51933-81-4 | 2A-1195316 |
| (αS,3S,5aS,8aS,9aS)-Decahydro-9a-hydroxy-3-Methyl-1,4-dioxo-α-(2-phenylethyl)-2H-cyclopenta[4,5]pyrrolo[1,2-a]pyrazine-2-acetic Acid Ethyl Ester | 1309040-96-7 | 2A-1195323 |
| 3-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-2-methylpyrido[1,2-a]pyrimidin-4-one | 108855-18-1 | 2A-1195330 |
| 7-Chlorobenzo[b]thiophene-3-Methanol | 142181-53-1 | 2A-1195333 |
| Potassium imidazole | 2A-1195344 | 2A-1195344 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA