
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 85686-97-1 |
| Catalog No. | 2A-2195169 |
| Chinese Name | 1,2-二氟-4,5-二硝基苯 |
| Synonyms | 4,5-difluoro-1,2-dinitrobenzene; 1,2-dinitro-4,5-difluorobenzene; 1,2-Difluoro-4,5-dinitrobenzene; Benzene,1,2-difluoro-4,5-dinitro |
| Molecular Formula | C8H8N2O6 |
| Molecular Weight | 228.16 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 337.0±37.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2904909090 |
| PubChem ID | 32535120 |
| MDL Number | MFCD00082695 |
| SMILES | O=[N+]([O-])c1cc(F)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H2F2N2O4/c7-3-1-5(9(11)12)6(10(13)14)2-4(3)8/h1-2H |
| InChI Key | XOAAAPHKZDETSB-UHFFFAOYSA-N |
| MSDS | msds/196850_1_85686_97_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-AMINO-4-BROMOBENZENETHIOL | 93933-49-4 | 2A-2195158 |
| Fondaparinux sodiuM interMediate A | 114870-02-9 | 2A-2195161 |
| Fondaparinux sodiuM interMediate B | 501092-87-1 | 2A-2195162 |
| Fondaparinux sodiuM interMediate C | 704210-18-4 | 2A-2195163 |
| Fondaparinux intermediate H | 99541-26-1 | 2A-2195167 |
| tert-Butyl 6-methylpiperidin-3-ylcarbamate | 1150618-39-5 | 2A-1195175 |
| BMS-986165 | 1609392-27-9 | 2A-1195178 |
| 2-Cyclopentene-1-carboxylicacid,4-amino- | 344326-33-6 | 2A-1195179 |
| Bis(3,5-dibromosalicyl) fumarate | 71337-53-6 | 2A-2195182 |
| Nalfurafine | 152658-17-8 | 2A-1195185 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA