
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 959119-22-3 |
| Catalog No. | 2A-1195138 |
| Chinese Name | 克拉霉素-N-甲基-13C, D3 |
| Molecular Formula | CH3C6H4SO2N(13CD3)NO |
| Molecular Weight | 218.25 |
| Purity | 98.00 |
| Melting Point | 62 °C (lit.) |
| Appearance | solid |
| Water Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Storage Condition | -20°C Freezer, Under inert atmosphere |
| Application | Clarithromycin-d3 is deuterium-labeled clarithromycin (HY-17508) [1]. Clarithromycin has broad-spectrum antibacterial activity. Clarithromycin inhibits the α-hydroxylation of triazolam catalyzed by CY |
| HTC | 9999999999 |
| PubChem ID | 24857828 |
| MDL Number | MFCD00002051 |
| SMILES | [2H][13C]([2H])([2H])N(N=O)S(=O)(=O)c1ccc(C)cc1 |
| InChI | 1S/C8H10N2O3S/c1-7-3-5-8(6-4-7)14(12,13)10(2)9-11/h3-6H,1-2H3/i2+1D3 |
| InChI Key | FFKZOUIEAHOBHW-JVXUGDAPSA-N |
| UNSPSC | 12352202 |
| MSDS | msds/196841_1_959119_22_3.pdf |
| Transport Info | Product name: (S)-Citalopram N-Oxide |
| Related Products in API & Advanced Intermediates | ||
|---|---|---|
| AzithroMycin Impurity | 194809-66-0 | 2A-1195101 |
| AZITHROMYCIN-D3 | 163921-65-1 | 2A-1195102 |
| 3-Oxo Atorvastatin | 887196-30-7 | 2A-1195118 |
| rac Des(isopropoxyethyl)-2-isopropoxyethoxymethyl Bisoprolol | 1215342-36-1 | 2A-1195136 |
| 4-Epi-6-epi Doxycycline | 97583-08-9 | 2A-1195137 |
| SALBUTAMOL HEMISULFATE | 36519-31-0 | 2A-2195217 |
| 10β-Hydroperoxy Norethindrone Acetate | 13236-11-8 | 2A-1195222 |
| (2S,3R)-Cabazitaxel | 1714967-27-7 | 2A-1195240 |
| Celecoxib Impurity | 170570-09-9 | 2A-2195255 |
| 7-DEOXYDOXORUBICINONE | 38554-25-5 | 2A-1195273 |
| Browse all API & Advanced Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA