
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5778-35-8 |
| Catalog No. | 2A-1194834 |
| Chinese Name | 2-(苄氧基)丙二酸二乙酯 |
| Synonyms | Benzyloxy-malonsaeure-diaethylester; ethyl benzyloxymalonate; ethyl 2-phenylmethoxypropanedioate; benzyloxy-malonic acid diethyl ester |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.297 |
| Density | 1.133g/cm3 |
| Boiling Point | 363.8ºC at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2918990090 |
| PubChem ID | 433445 |
| MDL Number | MFCD18430080 |
| SMILES | CCOC(=O)C(OCc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C14H18O5/c1-3-17-13(15)12(14(16)18-4-2)19-10-11-8-6-5-7-9-11/h5-9,12H,3-4,10H2,1-2H3 |
| InChI Key | YNLVMCVYVLXNGG-UHFFFAOYSA-N |
| MSDS | msds/196493_1_5778_35_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Naphthalenamine, 7-iodo- | 1261453-27-3 | 2A-1194825 |
| 2-Chloro-5,6-difluoronicotinonitrile | 1309371-71-8 | 2A-1194826 |
| 3-(prop-2-enamido)benzoic acid | 17090-28-7 | 2A-1194827 |
| Ethanone, 2-chloro-1-(2,3-dihydroxyphenyl)- (9CI) | 63704-55-2 | 2A-1194828 |
| N,N-dimethyl-2-(4-nitro-1H-pyrazol-1-yl)ethanamine | 1257078-45-7 | 2A-1194830 |
| Naphthalene, 2-iodo-6-methyl- | 1875-64-5 | 2A-1194835 |
| 2,6-DI-IODONAPHTHALENE | 36316-88-8 | 2A-1194836 |
| 2-Fluoro-6-iodonaphthalene | 59079-75-3 | 2A-1194837 |
| Naphthalene, 2-bromo-6-ethyl- | 67668-21-7 | 2A-1194838 |
| 1-Iodo-7-methylnaphthalene | 70109-76-1 | 2A-1194840 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA