
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 439087-18-0 |
| Catalog No. | 2A-1194743 |
| Chinese Name | A 3309 |
| Synonyms | UNII-865UEK4EJC; Elobixibat; AZD-7806; Elobixibat [INN] |
| Molecular Formula | C36H45N3O7S2 |
| Molecular Weight | 695.9 |
| Appearance | solid |
| Storage Condition | 2-8°C, sealed, dry |
| Application | Elobixibat is a potent ileal bile acid transporter (IBAT) inhibitor with IC50 values of 0.53±0.17 nM (human IBAT), 0.13±0.03 nM (mouse IBAT), and 5.8±1.6 nM (canine IBAT). |
| PubChem ID | 15111368 |
| MDL Number | C36H45N3O7S2 |
| SMILES | CCCCC1(CCCC)CN(c2ccccc2)c2cc(SC)c(OCC(=O)NC(C(=O)NCC(=O)O)c3ccccc3)cc2S(=O)(=O)C1 |
| InChI | InChI=1S/C36H45N3O7S2/c1-4-6-18-36(19-7-5-2)24-39(27-16-12-9-13-17-27)28-20-30(47-3)29(21-31(28)48(44,45)25-36)46-23-32(40)38-34(26-14-10-8-11-15-26)35(43)37-22-33(41)42/h8-17,20-21,34H,4-7,18-19,22-25H2,1-3H3,(H,37,43)(H,38,40)(H,41,42)/t34-/m1/s1 |
| InChI Key | XFLQIRAKKLNXRQ-UUWRZZSWSA-N |
| MSDS | msds/196399_1_439087_18_0.pdf |
| Transport Info | Product Name: Elobixibat |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Naphthalenol, 6-[2-(ethylamino)-4-methoxyphenyl]-5,6,7,8-tetrahydro- | 722520-42-5 | 2A-1194738 |
| 2-Naphthalenol, 6-(2-amino-4-methoxyphenyl)-5,6,7,8-tetrahydro- | 722520-36-7 | 2A-1194739 |
| Acetamide, N-[2-[3,4-dihydro-6-(phenylmethoxy)-2-naphthalenyl]-5-methoxyphenyl]- | 2477812-37-4 | 2A-1194740 |
| Acetamide, N-[5-methoxy-2-(1,2,3,4-tetrahydro-6-hydroxy-2-naphthalenyl)phenyl]- | 2477812-38-5 | 2A-1194741 |
| 1,5-Benzothiazepin-8-ol, 3,3-dibutyl-2,3,4,5-tetrahydro-7-(methylthio)-5-phenyl-, 1,1-dioxide | 439088-16-1 | 2A-1194742 |
| Manganese chloride tetrahydrate | 13446-35-9 | 2A-2194744 |
| N-BUTYLMAGNESIUM CHLORIDE (2 M IN THF) | 693-04-8 | 2A-2194745 |
| Acetylated octanoic acid glyceride | 2A-2194746 | 2A-2194746 |
| Lactic acid monostearate | 2A-2194748 | 2A-2194748 |
| Hydrophilic caprylic acid glyceride | 2A-2194749 | 2A-2194749 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA