
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 242812-04-0 |
| Catalog No. | 2A-1194679 |
| Chinese Name | 3-(2-氟苯氧基)苄溴 |
| Synonyms | 3'-Bromomethyl-2-fluorodiphenyl Ether; 3-(2-Fluorophenoxy)benzyl Bromide |
| Molecular Formula | C15H14BrNS |
| Molecular Weight | 320.254 |
| Density | 1.46 g/cm3 |
| Boiling Point | 313.4ºC at 760 mmHg |
| Appearance | Liquid;Colorless to Orange to Green clear liquid |
| Storage Condition | Storage method: in the refrigerator |
| PubChem ID | 3161205 |
| MDL Number | MFCD02670332 |
| SMILES | Fc1ccccc1Oc1cccc(CBr)c1 |
| InChI | InChI=1S/C13H10BrFO/c14-9-10-4-3-5-11(8-10)16-13-7-2-1-6-12(13)15/h1-8H,9H2 |
| InChI Key | FWAHWPGVFDHNCH-UHFFFAOYSA-N |
| MSDS | msds/196333_1_242812_04_0.pdf |
| Transport Info | Product name: Purity: 95.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Aluminum borohydride | 16962-07-5 | 2A-1194674 |
| Tetrahydro-2H-thiopyran-3-one | 19090-03-0 | 2A-1194675 |
| CYANOMETHYL FORMATE | 150760-95-5 | 2A-1194676 |
| 2-METHYL-1,5-HEPTADIENE | 6766-54-7 | 2A-1194677 |
| 1-hydrazino-2-propanol(SALTDATA: FREE) | 18501-20-7 | 2A-1194678 |
| 3,4'-DI-ISO-PROPYLBIPHENYL | 61434-46-6 | 2A-1194681 |
| NIOBIUM ETHOXIDE | 3236-82-6 | 2A-1194683 |
| 3-(1H-PYRAZOL-1-YL)ANILINE | 184097-88-9 | 2A-1194684 |
| 1-chloro-2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)propan-2-ol | 134818-67-0 | 2A-1194685 |
| 1-BroMo-4-tert-butyl-2-iodo-benzene | 916747-51-8 | 2A-1194687 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA