![1,2-Benzenediol, 4-[2-[(1-methylethyl)amino]ethyl]-, hydrochloride (1:1) structure, CAS 5178-52-9](/structures/210000/195481_1_5178_52_9.png)
CAS Number5178-52-9
SynonymsPyrocatechol,4-(2-(isopropylamino)ethyl)-,hydrochloride; 1-(3,4-Dihydroxyphenyl)-2-isopropylaminoethane hydrochloride; 1,2-Benzenediol,4-(2-((1-methylethyl)amino)ethyl)-,hydrochloride; Desoxyisoprenaline hydrochloride; Desoxyisoproterenol hydrochloride; Isopropyldopamine hydrochloride; 4-(2-(Isopropylamino)ethyl)pyrocatechol hydrochloride; WIN 5571; N-Isopropyldopamine hydrochloride
Molecular FormulaC11H18ClNO2
Molecular Weight231.71900
Purity98.00%
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5178-52-9 |
| Catalog No. | 2A-1193873 |
| Chinese Name | 4-[2-(propan-2-ylamino)ethyl]benzene-1,2-diol,hydrochloride |
| Synonyms | Pyrocatechol,4-(2-(isopropylamino)ethyl)-,hydrochloride; 1-(3,4-Dihydroxyphenyl)-2-isopropylaminoethane hydrochloride; 1,2-Benzenediol,4-(2-((1-methylethyl)amino)ethyl)-,hydrochloride; Desoxyisoprenaline hydrochloride; Desoxyisoproterenol hydrochloride; Isopropyldopamine hydrochloride; 4-(2-(Isopropylamino)ethyl)pyrocatechol hydrochloride; WIN 5571; N-Isopropyldopamine hydrochloride |
| Molecular Formula | C11H18ClNO2 |
| Molecular Weight | 231.71900 |
| Purity | 98.00 |
| HTC | 2922299090 |
| PubChem ID | 10263647 |
| SMILES | CC(C)NCCc1ccc(O)c(O)c1.Cl |
| InChI | InChI=1S/C11H17NO2.ClH/c1-8(2)12-6-5-9-3-4-10(13)11(14)7-9;/h3-4,7-8,12-14H,5-6H2,1-2H3;1H |
| InChI Key | MRYVSCVPICTKEY-UHFFFAOYSA-N |
| MSDS | msds/195481_1_5178_52_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Permanent Yellow HR70 | 2A-2193866 | 2A-2193866 |
| Permanent Yellow TR02 | 2A-2193867 | 2A-2193867 |
| yonggujuhuang | 2A-2193868 | 2A-2193868 |
| Everlasting Purple B | 2A-2193869 | 2A-2193869 |
| Everlasting Purple RH | 2A-2193870 | 2A-2193870 |
| 1,4-Benzenedisulfonic acid, 2-[4-(diethylamino)benzoyl]- | 2828260-22-4 | 2A-1193879 |
| 2-IODOISOPROPYLBENZENE | 19099-54-8 | 2A-2193881 |
| methyltributylammonium iodide | 3085-79-8 | 2A-2193883 |
| Tributyl(methyl)phosphonium iodide | 1702-42-7 | 2A-2193884 |
| METHYL 6-CHLORO-5-IODONICOTINATE | 365413-29-2 | 2A-2193886 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA