CAS Number22446-38-4
Synonyms3-hydroxyphenylacetic acid ethyl ester; ethyl m-hydroxyphenylacetate; Benzeneacetic acid,3-hydroxy-,ethyl ester; ETHYL 3-HYDROXYPHENYLACETATE
Molecular FormulaC10H12O3
Molecular Weight180.2
Density1.146g/cm3
Boiling Point292.5ºC at 760 mmHg
AppearanceSlightly light yellow-red-yellow transparent liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 22446-38-4 |
| Catalog No. | 2A-1193163 |
| Chinese Name | (3-羟苯基)乙酸乙酯 |
| Synonyms | 3-hydroxyphenylacetic acid ethyl ester; ethyl m-hydroxyphenylacetate; Benzeneacetic acid,3-hydroxy-,ethyl ester; ETHYL 3-HYDROXYPHENYLACETATE |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.2 |
| Density | 1.146g/cm3 |
| Boiling Point | 292.5ºC at 760 mmHg |
| Appearance | Slightly light yellow-red-yellow transparent liquid |
| Storage Condition | Room temperature, dry, inert gas storage |
| HTC | 2918290000 |
| PubChem ID | 8684324 |
| MDL Number | MFCD07369387 |
| SMILES | CCOC(=O)Cc1cccc(O)c1 |
| InChI | InChI=1S/C10H12O3/c1-2-13-10(12)7-8-4-3-5-9(11)6-8/h3-6,11H,2,7H2,1H3 |
| InChI Key | NSQBADKMIYCCSC-UHFFFAOYSA-N |
| MSDS | msds/194733_1_22446_38_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(2-ETHYL-2H-PYRAZOL-3-YL)-ETHANONE | 946655-79-4 | 2A-1193143 |
| (2,2-DIMETHYL-[1,3]-DIOXOLAN-4-YL)-METHYLAMINE | 22195-47-7 | 2A-4193154 |
| (S) QuinoxP(R) | 1107608-80-9 | 2A-1193158 |
| 5-[(3,4,6-Tri-O-acetyl-2-acetylamido-2-deoxy-b-D-galactopyranosyl)oxy]pentanoic acid | 1159408-54-4 | 2A-1193161 |
| 2-Bromo-6-iodonaphthalene | 389806-32-0 | 2A-1193162 |
| 4'-BROMO-2'-METHYLACETANILIDE | 24106-05-6 | 2A-1193164 |
| Benzenehexanoic acid, ε-oxo-, methyl ester | 21876-11-9 | 2A-1193152 |
| 6-PHENYLHEXANOIC ACID | 5581-75-9 | 2A-1193167 |
| Glycine, N-(1-oxo-6-phenylhexyl)- | 741694-69-9 | 2A-1193168 |
| 2-((benzyloxy)(4-ethoxyphenyl)methyl)-4-bromo-1-chlorobenzene | 1298086-15-3 | 2A-1193169 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS