
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 324-32-3 |
| Catalog No. | 2A-1193081 |
| Chinese Name | 2-甲基-7-(三氟甲基)喹啉 |
| Synonyms | 2-methyl-7-trifluoromethylquinoline; 2-Methyl-7-(trifluoromethyl)quinoline; 2-Methyl-7-trifluormethyl-chinolin; 7-trifluoromethylquinaldine |
| Molecular Formula | C11H8N1F3 |
| Molecular Weight | 211.19 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 253.1±35.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933499090 |
| PubChem ID | 38574117 |
| MDL Number | MFCD11108688 |
| SMILES | Cc1ccc2ccc(C(F)(F)F)cc2n1 |
| InChI | InChI=1S/C11H8F3N/c1-7-2-3-8-4-5-9(11(12,13)14)6-10(8)15-7/h2-6H,1H3 |
| InChI Key | VIBTYGFMDABZCD-UHFFFAOYSA-N |
| MSDS | msds/194644_1_324_32_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 6-CHLORO-CHROMAN-3-CARBOXYLIC ACID ETHYL ESTER | 885271-36-3 | 2A-1193074 |
| 5-NITRO-1H-INDAZOLE-3-CARBONITRILE | 90348-29-1 | 2A-1193075 |
| 5-Phenoxy-1,3-isobenzofurandione | 21345-01-7 | 2A-1193076 |
| 4-Nitro-isothiazole | 931-07-7 | 2A-1193077 |
| 6-BROMO-4-METHYL-1H-INDAZOLE | 885520-98-9 | 2A-1193078 |
| Pyrazolo[1,5-a]pyrimidine-6-carboxylic acid, 7-amino-3-methyl- (7CI) | 89977-62-8 | 2A-1193085 |
| METHYL 3-BROMO-1H-PYRROLO-[3,2-B]PYRIDINE-2-CARBOXYLATE | 952182-30-8 | 2A-1193086 |
| 2-Furancarboxylicacid,tetrahydro-4-oxo-,methylester(9CI) | 98136-12-0 | 2A-1193087 |
| tert-butyl 3-broMo-6,7-dihydropyrazolo[1,5-a]pyrazine-5(4H)-carboxylate | 1196154-25-2 | 2A-0200777 |
| 5,6,7,8-tetrahydro-4H-thieno[2,3-c]azepine hydrochloride | 1799420-94-2 | 2A-1193090 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA