
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 36369-34-3 |
| Catalog No. | 2A-1193059 |
| Chinese Name | (R)-2-(((苄氧基)羰基)氨基)-3-氟丙酸 |
| Synonyms | N-[(Benzyloxy)carbonyl]-3-fluoroalanine |
| Molecular Formula | C11H12O4N1F1 |
| Molecular Weight | 241.22 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 442.8±45.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2924299090 |
| PubChem ID | 53943718 |
| MDL Number | MFCD22372797 |
| SMILES | O=C(NC(CF)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C11H12FNO4/c12-6-9(10(14)15)13-11(16)17-7-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,16)(H,14,15)/t9-/m0/s1 |
| InChI Key | FXFJJOJQOPXMPP-VIFPVBQESA-N |
| MSDS | msds/194621_1_36369_34_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| 7-bromo-2-hydrazinylQuinoxaline | 145369-92-2 | 2A-1192999 |
| 7-Bromo-2-fluoroquinoxaline | 2251-59-4 | 2A-1193002 |
| tert-butyl (3R,4R)-rel-3-(benzylamino)-4-hydroxypyrrolidine-1-carboxylate | 1417175-15-5 | 2A-1193025 |
| Methyl (S)-2-(4-Hydroxyisoxazolidine-2-carbonyl)benzoate | 272459-61-7 | 2A-1193029 |
| (R)-9-(4-(1-(dimethylamino)propan-2-yl)phenyl)-8-hydroxythieno[2,3-c]quinolin-4(5H)-one hydrochloride | 1338545-01-9 | 2A-1193058 |
| (R)-N-Cbz-2-aMino-3-fluoropropanoic acid | 1235440-17-1 | 2A-1193060 |
| 3-chloro-5,6,7,8-tetrahydro-1,6-naphthyridine hydrochloride | 1260879-95-5 | 2A-1193071 |
| 6-broMo-4-chloro-7-(phenylsulfonyl)-7H-pyrrolo[2,3-d]pyriMidine | 784150-40-9 | 2A-1193073 |
| (1R,2S,5S)-rel-3-[(tert-butoxy)carbonyl]-3-azabicyclo[3.1.0]hexane-2-carboxylic acid | 1051393-66-8 | 2A-1193104 |
| N-Boc-trans-3-hydroxy-D-proline | 335280-19-8 | 2A-1193105 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA