
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 95262-09-2 |
| Catalog No. | 2A-1192969 |
| Chinese Name | 3-((4-溴苯基)氨基)-3-氧代丙酸 |
| Synonyms | 3-(4-Bromophenylamino)-3-oxopropanoic acid |
| Molecular Formula | C9H8O3N1Br1 |
| Molecular Weight | 258.07 |
| Density | 1.722±0.06 g/cm3 (20 °C, 760 mmHg) |
| Boiling Point | 495.2±30.0 °C (760 mmHg) |
| Melting Point | 169 °C |
| Storage Condition | 2-8°C, avoid light and dry |
| HTC | 2924299090 |
| PubChem ID | 5405794 |
| MDL Number | MFCD00201913 |
| SMILES | O=C(O)CC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C9H8BrNO3/c10-6-1-3-7(4-2-6)11-8(12)5-9(13)14/h1-4H,5H2,(H,11,12)(H,13,14) |
| InChI Key | DKYPQCCKJFPWKR-UHFFFAOYSA-N |
| MSDS | msds/194529_1_95262_09_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(4-methoxy)phenyl-3-methyl-5-pyrazolone | 60798-06-3 | 2A-1192958 |
| 4-BROMO-3-HYDROXYMETHYL-BENZONITRILE | 905710-66-9 | 2A-1192961 |
| 2-AMINO-5-BROMO-3-FLUORO-BENZONITRILE | 1209498-46-3 | 2A-1192963 |
| 2-Bromo-4,6-dimethyl-nicotinonitrile | 610279-99-7 | 2A-1192964 |
| (4-NITRO-PYRAZOL-1-YL)-ACETONITRILE | 1001500-47-5 | 2A-1192965 |
| 1-(Benzyloxy)-2-chloro-3-fluoro-4-nitrobenzene | 1632444-56-4 | 2A-1192970 |
| 2-amino-5-chloro-3-fluorobenzoic acid | 1028757-83-6 | 2A-1192972 |
| Benzamide, 2-amino-3-fluoro- (9CI) | 187805-54-5 | 2A-1192973 |
| (E)-2-cyano-3-cyclopropylacrylic acid | 98895-60-4 | 2A-1192976 |
| Benzoic acid, 4-[(cyclopropylmethyl)amino]- (9CI) | 518336-13-5 | 2A-1192979 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA