
CAS Number35480-52-5
Synonyms2,5-bis(2,2,2-trifluoroethoxy)benzoic acid (intermediate of flecainide acetate); FXFF1OR BVQ DO1XFFF; 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid; 2,5-Di(2,2,2-trifluoroethoxy)benzoic acid; 2,5-BIS(TRIFLUOROETHOXY)BENZOIC ACID; 2,5-Di(2,2,2-Trifluoroethoxy)B; BENZOIC ACID,2,5-BIS(2,2,2-TRIFLUOROETHOXY); MFCD00221424; 2.5-Bis-(2.2.2-trifluoroethoxy)-benzoesaeure; 2,4-DICHLORO-5-DIETHYLSULFAMOYL-BENZOIC ACID; 2,5-bis (2,2,2-trifluoroethoxy)benzoic acid
Molecular FormulaC11H8F6O4
Molecular Weight318.169
Purity97%
Density1.5±0.1 g/cm3
Boiling Point320.9±42.0 °C at 760 mmHg
Melting Point119-121ºC
Appearancewhite crystal powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 35480-52-5 |
| Catalog No. | 2A-9001944 |
| Chinese Name | 2,5-双(2,2,2-三氟乙氧基)苯甲酸 |
| Synonyms | 2,5-bis(2,2,2-trifluoroethoxy)benzoic acid (intermediate of flecainide acetate); FXFF1OR BVQ DO1XFFF; 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid; 2,5-Di(2,2,2-trifluoroethoxy)benzoic acid; 2,5-BIS(TRIFLUOROETHOXY)BENZOIC ACID; 2,5-Di(2,2,2-Trifluoroethoxy)B; BENZOIC ACID,2,5-BIS(2,2,2-TRIFLUOROETHOXY); MFCD00221424; 2.5-Bis-(2.2.2-trifluoroethoxy)-benzoesaeure; 2,4-DICHLORO-5-DIETHYLSULFAMOYL-BENZOIC ACID; 2,5-bis (2,2,2-trifluoroethoxy)benzoic acid |
| Molecular Formula | C11H8F6O4 |
| Molecular Weight | 318.169 |
| Purity | 97 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 320.9±42.0 °C at 760 mmHg |
| Melting Point | 119-121ºC |
| Appearance | white crystal powder |
| Storage Condition | Room Temperature |
| HTC | 2918990090 |
| SMILES | O=C(O)c1cc(OCC(F)(F)F)ccc1OCC(F)(F)F |
| InChI Key | YPGYLCZBZKRYQJ-UHFFFAOYSA-N |
| MSDS | msds/1944_1_35480_52_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 2,5-bis(2,2,2-trifluoroethoxy)benzoic acid Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,4'-Difluorobenzophenone | 342-25-6 | 2A-9001883 |
| 2',4'-Difluoropropiophenone | 85068-30-0 | 2A-9001905 |
| 2',4'-Dimethoxyacetophenone | 829-20-9 | 2A-9001918 |
| 2,4-Thiazolidinedione | 2295-31-0 | 2A-9001940 |
| 2,5-Bis(2,2,2-trifluoroethoxy)benzenesulphonyl chloride | 152457-95-9 | 2A-9001943 |
| 2',5'-DD-3'-ADP | 2A-101952 | 2A-9001952 |
| 2',5'-DD-3'-ATP | 2A-101953 | 2A-9001953 |
| 2,5-Diacetoacetamidobenzenesulfonic acid | 70185-87-4 | 2A-9001954 |
| 2,5-Diamino-1,3-benzenedisulfonic acid | 6409-48-9 | 2A-9001955 |
| 2,5-Diaminobenzotrifluoride | 364-13-6 | 2A-9001960 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA