
CAS Number88-66-4
Synonyms2-CHLOROBENZALCHLORIDE; 2-Chlorobenzal chloride; 2-Chloro-1-dichloromethylbenzene; o-chlorobenzylidene chloride; o-chlorobenzalchloride; 1-chloro-2-dichloromethyl-benzene; 2-Chlorobenzylidene dichloride; 2-Chlorophenyldichloromethane
Molecular FormulaC14H11Cl1
Molecular Weight214.69
Density1.384g/cm3
Boiling Point228.5ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 88-66-4 |
| Catalog No. | 2A-1192783 |
| Chinese Name | 1-氯-2-(二氯甲基)苯 |
| Synonyms | 2-CHLOROBENZALCHLORIDE; 2-Chlorobenzal chloride; 2-Chloro-1-dichloromethylbenzene; o-chlorobenzylidene chloride; o-chlorobenzalchloride; 1-chloro-2-dichloromethyl-benzene; 2-Chlorobenzylidene dichloride; 2-Chlorophenyldichloromethane |
| Molecular Formula | C14H11Cl1 |
| Molecular Weight | 214.69 |
| Density | 1.384g/cm3 |
| Boiling Point | 228.5ºC at 760 mmHg |
| HTC | 2903999090 |
| MDL Number | MFCD06658408 |
| SMILES | Clc1ccccc1C(Cl)Cl |
| InChI | InChI=1S/C7H5Cl3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,7H |
| InChI Key | BXSVYGKOUULJCL-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-Chloro-4-hydroxynicotinaldehyde | 1186310-65-5 | 2A-1192656 |
| 5-(broMoMethyl)undecane | 85531-02-8 | 2A-1192730 |
| 2-Oxo-4-phenylpyrrolidine-1-acetic acid hydrazide | 77472-71-0 | 2A-1192762 |
| PHENOL-FORMALDEHYDE RESIN | 9003-35-4 | 2A-1192770 |
| Formaldehyde, polymer with 4-(1,1,3,3-tetramethylbutyl)phenol | 26678-93-3 | 2A-1192772 |
| 4-(N-OCTYL)BENZENEBORONIC ACID | 133997-05-4 | 2A-1192817 |
| 2,2-DIFLUORO-BENZO[1,3]DIOXOLE-4-BORONIC ACID | 126120-87-4 | 2A-1192820 |
| 4-Phenylaminobenzaldehyde | 100727-07-9 | 2A-1192831 |
| 1,4-dioxa-10-azadispiro[4.2.4.2]tetradecan-11-one | 914780-95-3 | 2A-1192837 |
| 2-Cyclopenten-1-one, 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- | 1370008-65-3 | 2A-1192848 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA