![6-oxospiro[3.3]heptane-2- structure, CAS 889944-57-4](/structures/210000/193545_2_889944_57_4.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 889944-57-4 |
| Catalog No. | 2A-1192025 |
| Chinese Name | 6-氧代螺[3.3]庚烷-2-羧酸 |
| Synonyms | 6-oxospiro[3.3]heptane-2-carboxylic acid |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.17 |
| Boiling Point | 345.6±42.0°C |
| Storage Condition | room temperature, dry |
| HTC | 2918300090 |
| PubChem ID | 66005789 |
| SMILES | O=C1CC2(C1)CC(C(=O)O)C2 |
| InChI | InChI=1S/C8H10O3/c9-6-3-8(4-6)1-5(2-8)7(10)11/h5H,1-4H2,(H,10,11) |
| InChI Key | FGDRQRQOJRZARK-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| N'-(2-amino-6-chloro-5-formylpyrimidin-4-yl)furan-2-carbohydrazide | 2A-1191930 | 2A-1191930 |
| 6'-Dimethyl-4'-(N-succinimidyloxycarbonyl)phenyl-10-methyl-acridinium-9-carboxylate methosulfate (DMAE-NHS) | 115853-74-2 | 2A-1191936 |
| 7,9-dimethyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one | 2A-1191943 | 2A-1191943 |
| METHOXYACETIC ACID HYDRAZIDE | 20605-41-8 | 2A-1191967 |
| 1-Bromo-2-oxo-cyclohexanecarboxylic Acid Ethyl Ester | 34243-82-8 | 2A-1192008 |
| Phenol, 4-(chloromethyl)-2-methoxy- | 129111-11-1 | 2A-1192043 |
| METHYL 3,4-BIS(BROMOMETHYL)BENZOATE | 20896-23-5 | 2A-1192078 |
| 4-Azaandrost-5-ene-17-carboxylic acid, 3-oxo-, methyl ester, (17β)- | 104214-18-8 | 2A-1192100 |
| TERT-BUTYL 4-(BROMOMETHYL)PHENYLCARBAMATE | 239074-27-2 | 2A-1192177 |
| 1,1'-(bromomethylene)bis(4-fluorobenzene) | 345-90-4 | 2A-1192178 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA