
CAS Number93-72-1
Synonymsrac-(2R)-2-(2,4,5-trichlorophenoxy)propanoic acid; Kuran; MFCD00002646; (RS)-2-(2,4,5-trichlorophenoxy)propionic acid; 2-(2,4,5-trichlorophenoxy)propanoic acid; EINECS 202-271-2; Color-set; 2,4,5-TP; Sta-fast; Double strength; Fenoprop; Fenormone; Aqua-vex; 2,6-DIFLUOROPYRIDINE-3-BORONIC ACID HYDRATE; SILVEX; 2,4,5-trichlorophenoxypropionic acid; Propon
Molecular FormulaC9H7Cl3O3
Molecular Weight269.51
Density1.2085(20ºC )
Boiling Point378.4ºC at 760 mmHg
Melting Point175-180 °C
AppearanceSlightly beige crystalline powder
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 93-72-1 |
| Catalog No. | 2A-1191979 |
| Chinese Name | 2,4,5-涕丙酸 |
| Synonyms | rac-(2R)-2-(2,4,5-trichlorophenoxy)propanoic acid; Kuran; MFCD00002646; (RS)-2-(2,4,5-trichlorophenoxy)propionic acid; 2-(2,4,5-trichlorophenoxy)propanoic acid; EINECS 202-271-2; Color-set; 2,4,5-TP; Sta-fast; Double strength; Fenoprop; Fenormone; Aqua-vex; 2,6-DIFLUOROPYRIDINE-3-BORONIC ACID HYDRATE; SILVEX; 2,4,5-trichlorophenoxypropionic acid; Propon |
| Molecular Formula | C9H7Cl3O3 |
| Molecular Weight | 269.51 |
| Density | 1.2085(20ºC ) |
| Boiling Point | 378.4ºC at 760 mmHg |
| Melting Point | 175-180 °C |
| Appearance | Slightly beige crystalline powder |
| Storage Condition | This product should be sealed and stored away from |
| Packaging | III |
| HTC | 2918990090 |
| PubChem ID | 3136994 |
| SMILES | CC(Oc1cc(Cl)c(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C9H7Cl3O3/c1-4(9(13)14)15-8-3-6(11)5(10)2-7(8)12/h2-4H,1H3,(H,13,14) |
| InChI Key | ZLSWBLPERHFHIS-UHFFFAOYSA-N |
| Hazard Symbols | 9 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Chemical name |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| N-[(2,4-DIMETHOXYPHENYL)METHYL]-1,2,4-THIADIAZOL-5-AMINE | 1063733-41-4 | 2A-1191793 |
| Ethanone, 1-(1,2,4,5-tetrahydro-7,8-dinitro-1,5-methano-3H-3-benzazepin-3-yl)- | 1213782-02-5 | 2A-1191858 |
| (4-(1,2,4,5-Tetrazin-3-yl)phenyl)methanamine hydrochloride | 1345866-68-3 | 2A-1191926 |
| (2E)-3-(1,2,3,4-tetrahydro- 2,4-dioxopyrimidin-5-yl)acrylic acid | 90402-62-3 | 2A-1191945 |
| 1,2,3,4-tetrahydro-2,4-dio xopyrimidine-5-carbaldehyde | 2A-1191947 | 2A-1191947 |
| 3(2H)-Thiophenone, 2,4-dimethyl- | 121132-94-3 | 2A-1192045 |
| S-metolachlor+Terbuthylazine+Topramezone | 87392-12-9+5915-41-3+210631-68-8 | 2A-1192119 |
| Glufosinate-p(Glufosinate-p ammonium salt) | 2A-1192120 | 2A-1192120 |
| Flucarbazone-Na | 2A-1192127 | 2A-1192127 |
| 1-beta-D-arabinofuranosyl-5-fluoro-(1H,3H)-pyrimidine-2,4-dione | 131-06-6 | 2A-1192147 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA