
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 146368-13-0 |
| Catalog No. | 2A-1191938 |
| Chinese Name | 磺酸基-Cy3羧酸 |
| Synonyms | Dye Reagents; References |
| Molecular Formula | C31H38O8N2S2 |
| Molecular Weight | 630.78 |
| Appearance | Solid;Green to Dark green powder to crystal |
| Storage Condition | -20°C; store in inert gas; avoid light, moisture ( |
| Application | Zy3 carboxylic acid (Compound 7c) is a new cyanine dye that can be used to label biomolecules. The maximum absorption wavelength (λem) is 549 nm. The maximum emission wavelength (λem) is 566 nm. |
| PubChem ID | 336421287 |
| MDL Number | MFCD28978247 |
| SMILES | CCN1C(=CC=CC2=[N+](CCCCCC(=O)O)c3ccc(S(=O)(=O)O)cc3C2(C)C)C(C)(C)c2cc(S(=O)(=O)[O-])ccc21 |
| InChI | InChI=1S/C31H38N2O8S2/c1-6-32-25-16-14-21(42(36,37)38)19-23(25)30(2,3)27(32)11-10-12-28-31(4,5)24-20-22(43(39,40)41)15-17-26(24)33(28)18-9-7-8-13-29(34)35/h10-12,14-17,19-20H,6-9,13,18H2,1-5H3,(H2-,34,35,36,37,38,39,40,41) |
| InChI Key | YDNYBBRGPORVRT-UHFFFAOYSA-N |
| Transport Info | Product name: Cyanide dye cy3 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-bromo-7-methoxy-4-methylchromen-2-one | 75908-67-7 | 2A-1191918 |
| 4',5-Dichloro-2-hydroxy benzophenone | 2A-1191920 | 2A-1191920 |
| 3,5,2'-Trichloro-2-hydroxy benzophenone | 99585-49-6 | 2A-1191921 |
| DODMA | 104162-47-2 | 2A-1191932 |
| DOTAP | 144189-73-1 | 2A-1191934 |
| 1,3-di[(phenyl)-ethenyl]-benzene | 34241-86-6 | 2A-1191948 |
| 4,5-bis(2-chloroethyl)-1,3-dioxolan-2-one | 1443544-27-1 | 2A-1191949 |
| 2-(benzyloxy)ethanesulfonamide | 881407-21-2 | 2A-1191950 |
| (2-Nitrophenyl)-phosphoric triamide | 874819-71-3 | 2A-1191955 |
| methyl 2-(2-phenylacetyl)benzoate | 2A-1191962 | 2A-1191962 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA