CAS Number3618-03-9
SynonymsHYDROXYCYCLOHEXANECARBOXYLIC ACID METHYL ESTER; METHYL 4-HYDROXYCYCLOHEXANE-1-CARBOXYLATE; methyl 4-hydroxy-1-cyclohexanecarboxylate; Cyclohexanecarboxylic acid,4-hydroxy-,methyl ester; cyclohexanol-4-carboxylic acid methyl ester; methyl-4-hydroxycyclohexane carboxylate; 4-Carbomethoxycyclohexanol; 4-hydroxy-cyclohexane carboxylic acid methyl ester
Molecular FormulaC8H14O3
Molecular Weight158.2
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3618-03-9 |
| Catalog No. | 2A-1191667 |
| Chinese Name | 顺式-4-羟基环己烷甲酸甲酯 |
| Synonyms | HYDROXYCYCLOHEXANECARBOXYLIC ACID METHYL ESTER; METHYL 4-HYDROXYCYCLOHEXANE-1-CARBOXYLATE; methyl 4-hydroxy-1-cyclohexanecarboxylate; Cyclohexanecarboxylic acid,4-hydroxy-,methyl ester; cyclohexanol-4-carboxylic acid methyl ester; methyl-4-hydroxycyclohexane carboxylate; 4-Carbomethoxycyclohexanol; 4-hydroxy-cyclohexane carboxylic acid methyl ester |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.2 |
| Storage Condition | -20℃, dry, sealed |
| HTC | 2918199090 |
| PubChem ID | 3250240 |
| MDL Number | MFCD20441962 |
| InChI | InChI=1S/C8H14O3/c1-11-8(10)6-2-4-7(9)5-3-6/h6-7,9H,2-5H2,1H3 |
| InChI Key | HYDYVXROZHFTGB-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-Bromo-6-fluoro-2-hydroxy-benzaldehyde | 199287-82-6 | 2A-1191644 |
| 4-CYANO-3,5-DIFLUOROPHENYLBORONIC ACID | 861710-03-4 | 2A-1191649 |
| 2-(3-(Difluoromethoxy)-4-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | 1641580-18-8 | 2A-1191651 |
| 4-Fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde | 1844839-22-0 | 2A-1191656 |
| Cyclobutanecarboxylic acid, 3,3-difluoro-, ethyl ester (9CI) | 681128-38-1 | 2A-1191664 |
| 6,6-difluoro-2-azaspiro[3.3]heptane hydrochloride | 1420294-83-2 | 2A-1191686 |
| 4-Fluoro-3-(trifluoromethyl)phenylboronic acid pinacol ester | 445303-14-0 | 2A-1191693 |
| 1-Methyl-4-oxopiperidin-3-carboxylic acid ethyl ester | 25012-72-0 | 2A-1191775 |
| TERT-BUTYL 2-(BROMOMETHYL)PHENYLCARBAMATE | 166329-43-7 | 2A-1191780 |
| TERT-BUTYL 2-(BROMOMETHYL)PHENYLCARBAMATE | 282102-05-0 | 2A-1191781 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS