
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 958458-89-4 |
| Catalog No. | 2A-1191589 |
| Chinese Name | 1-溴-2-氟-3-碘苯 |
| Synonyms | 3-Bromo-2-fluoroiodobenzene; MFCD13194483 |
| Molecular Formula | C6H3BrFI |
| Molecular Weight | 300.9 |
| Density | 2.3±0.1 g/cm3 |
| Boiling Point | 248.8±25.0 °C at 760 mmHg |
| Storage Condition | Room temperature, protected from light, dry and se |
| HTC | 2903999090 |
| PubChem ID | 31603322 |
| SMILES | Fc1c(Br)cccc1I |
| InChI | InChI=1S/C6H3BrFI/c7-4-2-1-3-5(9)6(4)8/h1-3H |
| InChI Key | AEBOPKUWEXVTNN-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| CYCLIC CYTIDYLIC ACID SODIUM SALT | 15718-51-1 | 2A-4191576 |
| TRICYCLOHEXYL BORATE | 2467-16-5 | 2A-1191509 |
| ETHYL 6-ISOCYANATOHEXANOATE | 5100-36-7 | 2A-4191582 |
| 3-BROMO-5-CHLORO-2-FLUOROANILINE | 1269232-95-2 | 2A-1191584 |
| DIMETHYLMALONONITRILE | 7321-55-3 | 2A-1191585 |
| 3-Methyl-2-butanone | 563-84-0 | 2A-1191591 |
| 2-METHYL-3-PENTANONE | 566-69-5 | 2A-1191592 |
| N-([1,1'-biphenyl]-2-yl)dibenzo[b,d]thiophen-2-amine | 2170534-12-8 | 2A-1191598 |
| Benzenamine, 4-benzo[b]thien-2-yl- | 54492-95-4 | 2A-1191600 |
| 1-IODO-2-PHENOXY-BENZENE | 34883-46-0 | 2A-1191602 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA