
CAS Number21884-26-4
SynonymsIsopropyl 4-oxopentanoate; 2-propyl levulinate; Pentanoic acid,4-oxo-,1-methylethyl ester; 4-oxo-pentanoic acid,1-methylethyl ester; Pentanoic acid, 4-oxo-, 1-methylethyl ester; Isopropyl 4-oxovalerate; iso-Propyl levulinate; levulinic acid isopropyl ester; Laevulinsaeure-isopropylester
Molecular FormulaC8H14O3
Molecular Weight158.195
Density1.0±0.1 g/cm3
Boiling Point209.3±0.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 21884-26-4 |
| Catalog No. | 2A-1191540 |
| Chinese Name | 乙酰丙酸异丙酯 |
| Synonyms | Isopropyl 4-oxopentanoate; 2-propyl levulinate; Pentanoic acid,4-oxo-,1-methylethyl ester; 4-oxo-pentanoic acid,1-methylethyl ester; Pentanoic acid, 4-oxo-, 1-methylethyl ester; Isopropyl 4-oxovalerate; iso-Propyl levulinate; levulinic acid isopropyl ester; Laevulinsaeure-isopropylester |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.195 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 209.3±0.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2918300090 |
| SMILES | CC(=O)CCC(=O)OC(C)C |
| InChI | InChI=1S/C8H14O3/c1-6(2)11-8(10)5-4-7(3)9/h6H,4-5H2,1-3H3 |
| InChI Key | MGJRGGIHFUREHT-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-amino-2-methyl-butan-2-ol | 6291-17-4 | 2A-1191527 |
| 2-(4-Bromo-2-fluorophenyl)thiazol-4-amine | 1601185-31-2 | 2A-1191532 |
| 4-(Chlorosulfonyl)benzamide | 885526-86-3 | 2A-1191535 |
| 2,3,4-Trichlorobenzyl bromide | 219765-45-4 | 2A-1191537 |
| SulbactaM M-1 | 23315-18-6 | 2A-1191539 |
| N-Butyl-6-chloropyrazin-2-amine | 951884-06-3 | 2A-1191541 |
| 4,4'-METHYLENEBIS(2,6-DIMETHYLPHENOL) | 5384-21-4 | 2A-1191547 |
| (6-Chloro-pyridin-2-yl)-diMethyl-aMine | 1060801-42-4 | 2A-1191548 |
| 5-chloro-N-(2-chlorophenyl)-2-hydroxy-benzaMide | 6626-92-2 | 2A-1191549 |
| sodium octyldithiocarbamate | 22889-65-2 | 2A-1191551 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA