
CAS Number19012-02-3
Synonyms1-(1-methyl-1H-3-indolyl)-1-ethanone; 1-methyl-3-acetyl-1H-indole; 1-(1-methyl-1H-indol-3-yl)ethanone; 3-acetyl-1-methylindole; HYLFRICFKVJJOZ-UHFFFAOYSA; 1-(1-Methyl-1H-indol-3-yl)-1-ethanone; 1-methyl-3-acetyl-indole
Molecular FormulaC11H11NO
Molecular Weight173.21
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 19012-02-3 |
| Catalog No. | 2A-1191231 |
| Chinese Name | 1-(1-甲基-1H-吲哚-3-基)-1-乙酮 |
| Synonyms | 1-(1-methyl-1H-3-indolyl)-1-ethanone; 1-methyl-3-acetyl-1H-indole; 1-(1-methyl-1H-indol-3-yl)ethanone; 3-acetyl-1-methylindole; HYLFRICFKVJJOZ-UHFFFAOYSA; 1-(1-Methyl-1H-indol-3-yl)-1-ethanone; 1-methyl-3-acetyl-indole |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933990090 |
| PubChem ID | 3177983 |
| SMILES | CC(=O)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C11H11NO/c1-8(13)10-7-12(2)11-6-4-3-5-9(10)11/h3-7H,1-2H3 |
| InChI Key | HYLFRICFKVJJOZ-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Bromo-1-(3-fluoro-4-methoxyphenyl)ethanone | 350-27-6 | 2A-1191224 |
| Ethanone, 2-bromo-1-[4-(1-methylethyl)phenyl]- | 51012-62-5 | 2A-1191225 |
| 4-Chloro-3,5-dinitro-benzophenone | 40646-73-9 | 2A-1191226 |
| 2-Fluoro-1-methoxy-3-nitrobenzene | 445-68-1 | 2A-1191227 |
| 4-Bromo-7-fluoro-1-indanone | 1003048-72-3 | 2A-1191230 |
| Benzeneacetonitrile, 4-(octadecyloxy)- | 80280-48-4 | 2A-1191162 |
| TERT-BUTYL 2-IODOTHIOPHEN-3-YLCARBAMATE | 149704-10-9 | 2A-1191241 |
| tert-butyl (2-broMothiophen-3-yl)carbaMate | 21483-64-7 | 2A-1191242 |
| 2-Hydroxy-3-(3-hydroxy-phenyl)-propionic acid | 3247-74-3 | 2A-1191244 |
| TMSEP | 317809-68-0 | 2A-1191245 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA