
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 116278-69-4 |
| Catalog No. | 2A-1191219 |
| Chinese Name | 6-氨基-2,3-二氯苯酚 |
| Synonyms | 6-Amino-2,3-dichlorophenol; 2-amino-5,6 dichlorophenol; .2-amino-5,6-dichlorophenol |
| Molecular Formula | C6H5O1N1Cl2 |
| Molecular Weight | 178.02 |
| Storage Condition | 2-8°C |
| HTC | 2922299090 |
| PubChem ID | 53883318 |
| MDL Number | MFCD20693682 |
| SMILES | Nc1ccc(Cl)c(Cl)c1O |
| InChI | InChI=1S/C6H5Cl2NO/c7-3-1-2-4(9)6(10)5(3)8/h1-2,10H,9H2 |
| InChI Key | LBKNLCXXJZQFHU-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| O-[2-(2-chlorophenyl)ethyl]hydroxylamine | 113211-45-3 | 2A-1191214 |
| 2-METHOXY-6-NITROPHENOL | 15969-08-1 | 2A-1191215 |
| 3-Methoxy-2-nitrophenol | 3114-61-2 | 2A-1191216 |
| 2-Amino-3-methoxyphenol | 40925-69-7 | 2A-1191217 |
| 2-Amino-6-methoxyphenol | 40925-71-1 | 2A-1191218 |
| 2-Bromo-1-(1-phenylpyrazol-4-yl)ethanone | 91062-67-8 | 2A-1191221 |
| 2-Bromo-1-(2,3-dihydro-1H-inden-5-yl)ethan-1-one | 39696-16-7 | 2A-1191222 |
| 2-Bromo-1-(3-fluoro-4-methylphenyl)ethanone | 505097-09-6 | 2A-1191223 |
| 2-Bromo-1-(3-fluoro-4-methoxyphenyl)ethanone | 350-27-6 | 2A-1191224 |
| Ethanone, 2-bromo-1-[4-(1-methylethyl)phenyl]- | 51012-62-5 | 2A-1191225 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA