CAS Number204707-42-6
SynonymsMethyl 4-fluoro-2-methoxybenzoate; 1OVR DF BO1; 4-Fluoro-2-methoxybenzoic acid methyl ester; Benzoic acid, 4-fluoro-2-methoxy-, methyl ester; Methyl 4-fluoro-o-anisate
Molecular FormulaC9H9FO3
Molecular Weight184.17
Density1.2±0.1 g/cm3
Boiling Point231.6±20.0 °C at 760 mmHg
Melting Point134-136ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 204707-42-6 |
| Catalog No. | 2A-1191177 |
| Chinese Name | 4-氟-2-甲氧基苯甲酸甲酯 |
| Synonyms | Methyl 4-fluoro-2-methoxybenzoate; 1OVR DF BO1; 4-Fluoro-2-methoxybenzoic acid methyl ester; Benzoic acid, 4-fluoro-2-methoxy-, methyl ester; Methyl 4-fluoro-o-anisate |
| Molecular Formula | C9H9FO3 |
| Molecular Weight | 184.17 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 231.6±20.0 °C at 760 mmHg |
| Melting Point | 134-136ºC |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2918990090 |
| PubChem ID | 15243735 |
| SMILES | COC(=O)c1ccc(F)cc1OC |
| InChI | InChI=1S/C9H9FO3/c1-12-8-5-6(10)3-4-7(8)9(11)13-2/h3-5H,1-2H3 |
| InChI Key | LJUAEPNTXDJBRX-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| (4-FLUORO-BENZOYLAMINO)-ACETIC ACID | 366-79-0 | 2A-1191172 |
| N-ISOBUTYRYLGLYCINE | 15926-18-8 | 2A-1191173 |
| (PHENOXYACETYL)AMINO]ACETIC ACID | 14231-45-9 | 2A-1191174 |
| (3-METHOXY-BENZOYLAMINO)-ACETIC ACID | 57728-61-7 | 2A-1191175 |
| N-(Cyclobutylcarbonyl)-2-methylalanine | 1219960-66-3 | 2A-1191176 |
| N-Benzoyl-2-methylalanine | 57224-51-8 | 2A-1191177 |
| 3,4-DIMETHYLHIPPURIC ACID | 23082-12-4 | 2A-1191178 |
| 3-METHYLAZETIDIN-3-OL HYDROCHLORIDE | 124668-46-8 | 2A-1191178 |
| hexahydrohippurate | 32377-88-1 | 2A-1191179 |
| 5-Bromo-2-nitro-3-Pyridinol | 691872-15-8 | 2A-1191179 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS