
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 107485-63-2 |
| Catalog No. | 2A-1190824 |
| Chinese Name | 2-溴-6-氟苯甲酰胺 |
| Synonyms | 6-bromo-2-fluorobenzamide; 2-fluoro-6-bromobenzamide |
| Molecular Formula | C7H5BrFNO |
| Molecular Weight | 218.03 |
| Density | 1.696g/cm3 |
| Boiling Point | 250.5ºC at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2924299090 |
| PubChem ID | 3220862 |
| SMILES | NC(=O)c1c(F)cccc1Br |
| InChI | InChI=1S/C7H5BrFNO/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H2,10,11) |
| InChI Key | ISOBQSJJWXAPFP-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Geranic acid 85% stabilized | 459-80-3 | 2A-1190818 |
| 2-AMINO-5-CHLOROBENZYL ALCOHOL | 37585-25-4 | 2A-1190819 |
| 2,2,2,3'-TETRAFLUOROACETOPHENONE | 708-64-5 | 2A-1190820 |
| 2-(3,5-DIFLUOROPHENYL)ETHANOYL CHLORIDE | 157033-24-4 | 2A-1190821 |
| 2,5-DIFLUORO-4-METHOXYBENZONITRILE | 1007605-44-8 | 2A-1190823 |
| 2-[3-(difluoroMethoxy)phenyl]acetic acid | 262587-06-4 | 2A-1190826 |
| 2-BroMo-4-Methoxy-6-nitroaniline | 10172-35-7 | 2A-1190827 |
| (hexyloxy)acetic acid | 57931-25-6 | 2A-1190829 |
| DFSX-2 | 442526-91-2 | 2A-1190831 |
| 2-amino-2-phenylbutan-1-ol | 39068-91-2 | 2A-1190835 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA