CAS Number53856-93-2
Synonyms5-bromolevulinic acid methyl ester; methyl 5-bromo-4-oxo-pentanoate; methyl 5-bromolevulinate; 5-Brom-4-oxo-valeriansaeure-methylester; 5-bromo-4-oxo-valeric acid methyl ester; 5-bromo-4-oxo-pentanoic acid methyl ester; Pentanoic acid,5-bromo-4-oxo-,methyl ester
Molecular FormulaC6H9BrO3
Molecular Weight209.04
Density1.478±0.06 g/cm3
Boiling Point125-128 °C at 760 mmHg
AppearanceColorless to light yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 53856-93-2 |
| Catalog No. | 2A-1190707 |
| Chinese Name | 4-氧代-5-溴戊酸甲酯 |
| Synonyms | 5-bromolevulinic acid methyl ester; methyl 5-bromo-4-oxo-pentanoate; methyl 5-bromolevulinate; 5-Brom-4-oxo-valeriansaeure-methylester; 5-bromo-4-oxo-valeric acid methyl ester; 5-bromo-4-oxo-pentanoic acid methyl ester; Pentanoic acid,5-bromo-4-oxo-,methyl ester |
| Molecular Formula | C6H9BrO3 |
| Molecular Weight | 209.04 |
| Density | 1.478±0.06 g/cm3 |
| Boiling Point | 125-128 °C at 760 mmHg |
| Appearance | Colorless to light yellow liquid |
| Storage Condition | 2-8°C, inert atmosphere |
| HTC | 2918300090 |
| PubChem ID | 14818788 |
| SMILES | COC(=O)CCC(=O)CBr |
| InChI | InChI=1S/C6H9BrO3/c1-10-6(9)3-2-5(8)4-7/h2-4H2,1H3 |
| InChI Key | AUQDWNOSVDUIAT-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4,16-DIBROMO[2.2]PARACYCLOPHANE | 96392-77-7 | 2A-1190702 |
| 1-Propylpiperidin-4-amine.HCl | 1158561-84-2 | 2A-1190703 |
| azimilide | 149888-94-8 | 2A-1190704 |
| N-benzyl-4-chloro-N-cyclohexylbenzaMide | 945714-67-0 | 2A-1190705 |
| L-Proline, 5-methyl-, ethyl ester, (5S)- (9CI) | 676560-84-2 | 2A-1190706 |
| Benzoic acid, 3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]-, Methyl ester | 775304-60-4 | 2A-1190708 |
| 4-hydroxybutanethiol | 14970-83-3 | 2A-1190708 |
| Pent-4-yn-2-ol | 2117-11-5 | 2A-1190710 |
| benzyldimethyl(3-methyl-1H- inden-1-yl)silane | 2A-1190712 | 2A-1190712 |
| 1,3-dimethyl-1H-indene | 2177-48-2 | 2A-1190713 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS