
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6913-23-1 |
| Catalog No. | 2A-1190574 |
| Chinese Name | 2-巯基-5-噻唑烷酮 |
| Synonyms | 2-mercapto-5-thiazolidone |
| Molecular Formula | C3H5NOS2 |
| Molecular Weight | 195.20 |
| Melting Point | 168.5ºC (CAPILLARY); 170.5-171ºC (HOT STAGE) |
| Appearance | Solid;White to Orange to Green powder to crystal |
| Storage Condition | <0°C; store in inert gas; avoid air, heat |
| HTC | 2934999090 |
| PubChem ID | 24855984 |
| MDL Number | MFCD00804727 |
| SMILES | O=C1CSC(=S)N1 |
| InChI | InChI=1S/C3H3NOS2/c5-2-1-7-3(6)4-2/h1H2,(H,4,5,6) |
| InChI Key | InChIKey=KIWUVOGUEXMXSV-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| eCl@ss | 32151614 |
| UNSPSC | 12352100 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5,4-Dimethoxy flavanone | 2A-1190566 | 2A-1190566 |
| 6,3'-Dimethoxy flavanone | 2A-1190567 | 2A-1190567 |
| 2'-Hydroxy flavanone | 35244-11-2 | 2A-1190568 |
| 3'-Hydroxy flavanone | 92496-65-6 | 2A-1190569 |
| 4'-Hydroxy flavanone | 2A-1190570 | 2A-1190570 |
| BROMOCRESOL GREEN SODIUM SALT | 67763-24-0 | 2A-1190575 |
| D-ribo-Hexanoic acid, 3-deoxy-, γ-lactone | 499-87-6 | 2A-1190577 |
| 3,3'-(Phenylphosphinylidene)bis-2-thiazolidinethione | 91793-77-0 | 2A-1190580 |
| 3,3'-(1,3-Phenylenedicarbonyl)bis-2-thiazolidinethione | 77929-24-9 | 2A-1190582 |
| 4'-Hydroxy-3'-Methoxy flavanone | 5438-64-2 | 2A-1190571 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA