
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 83304-60-3 |
| Catalog No. | 2A-1190448 |
| Chinese Name | N-苄基-1-(2,4-二甲氧基苯基)甲胺 |
| Synonyms | MFCD01135686 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.32800 |
| Purity | 98.00 |
| Boiling Point | 378.1ºC at 760 mmHg |
| Storage Condition | 2-8°C, sealed, dry |
| HTC | 2922299090 |
| PubChem ID | 4081394 |
| SMILES | COc1ccc(CNCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C16H19NO2/c1-18-15-9-8-14(16(10-15)19-2)12-17-11-13-6-4-3-5-7-13/h3-10,17H,11-12H2,1-2H3/p+1 |
| InChI Key | NUNNRGRUURRZRA-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| METHYL 2,4-DIHYDROXY-6-METHYLNICOTINATE | 893616-55-2 | 2A-1189659 |
| 3-(2-AMINOETHYL)-1,3-THIAZOLIDINE-2,4-DIONE HYDROCHLORIDE | 39137-36-5 | 2A-2189763 |
| 1,3,5-Triazine-2,4(1H,3H)-dione, 6-[(6-chloro-2-methyl-2H-indazol-5-yl)imino]dihydro-3-[(1-methyl-1H-1,2,4-triazol-3-yl)methyl]-1-[(2,4,5-trifluorophenyl)methyl]-, (6E)- | 2647530-73-0 | 2A-1190170 |
| 3,6-Dichloro-1,2,4,5-tetrazine | 106131-61-7 | 2A-1190237 |
| 2,4-dichloro-6-(naphthalen-1-yl)-1,3,5-triazine | 59336-36-6 | 2A-1190405 |
| diethyl 2,4-dibromopentanedioate | 870-78-0 | 2A-1190455 |
| 5-(2,4-DICHLOROBENZYLTHIO)-2-MERCAPTO-1,3,4-THIADIAZOLE | 136384-19-5 | 2A-1190581 |
| benzenepropanoic acid, α-[[(6-amino-3,5-difluoro-2-pyridinyl)amino]methylene]-2,4,5-trifluoro-β-oxo-, ethyl ester | 875712-88-2 | 2A-1190834 |
| 2,4-Dymethyl Phenylmagnesium Bromide - 0.5 M in THF | 34589-46-3 | 2A-1191007 |
| Mefenpyr-diethyl | 135590-91-9 | 2A-1191092 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA