
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 189230-41-9 |
| Catalog No. | 2A-1190052 |
| Chinese Name | 2-溴吡啶-3,4-二胺 |
| Synonyms | 3,4-Pyridinediamine,2-bromo; 3,4-Diamino-2-bromopyridine; 2-Bromo-pyridine-3,4-diamine; QC-72 |
| Molecular Formula | C5H6BrN3 |
| Molecular Weight | 188.03 |
| Density | 1.818±0.06 g/cm3(Predicted) |
| Boiling Point | 397.0±37.0 °C(Predicted) |
| Appearance | Yellow to brown solid |
| Storage Condition | 2-8°C, protected from light |
| HTC | 2933399090 |
| PubChem ID | 122252127 |
| InChI | InChI=1S/C5H6BrN3/c6-5-4(8)3(7)1-2-9-5/h1-2H,8H2,(H2,7,9) |
| InChI Key | XXYYHVZFUOKDPI-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 6,12-diphenyl-5,11-dihydroindolo[3,2-b]carbazole | 910217-11-7 | 2A-1190045 |
| 4-(2-phenylethynyl)pyridine | 13295-94-8 | 2A-1190046 |
| 4,7-Bis(5-broMo-4-hexylthiophen-2-yl)benzo[c][1,2,5]thiadiazole | 444579-39-9 | 2A-1190048 |
| 4-(Biphenyl-4-yl)-6-(4-bromophenyl)-2-phenylpyrimidine | 1421599-34-9 | 2A-1190049 |
| (E)-2,2'-Azodipyridine | 4109-58-4 | 2A-1190051 |
| 4,7-Bis(2-3MeSn-5-thienyl)-2,1,3-benzothiadiazole | 1025451-57-3 | 2A-1190053 |
| Indolo[3,2-b]carbazole, 5,11-dihydro-6-phenyl- | 910111-99-8 | 2A-1190055 |
| 2,5-bis(2-ethylhexyl)-3,6-di(thiophen-2-yl)pyrrolo[3,4-c]pyrrole-1,4(2H,5H)-dione | 1185885-86-2 | 2A-1190056 |
| 2,5-Dihydro-2,5-bis(2-octyldodecyl)-3,6-bis[5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)-thiophen-2-yl]pyrrolo[3,4-c]pyrrol-1,4-dione | 1351986-34-9 | 2A-1190057 |
| 4,7-Bis(5-broMo-4-dodecylthiophen-2-yl)benzo[c][1,2,5]thiadiazole | 1179993-72-6 | 2A-1190058 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA