
CAS Number15131-89-2
Synonyms3-(Dimethylamino)-2-phenylacrolein; 3-dimethylamino-2-phenyl-acrylaldehyde; 3-dimethylamino-2-phenyl-propenal; 3-Dimethylamino-2-phenyl-acrylaldehyd; 2-Phenyl-3-(dimethylamino)acrolein
Molecular FormulaC11H12N2
Molecular Weight172.232
Density1.022g/cm3
Boiling Point394.5ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 15131-89-2 |
| Catalog No. | 2A-2189781 |
| Chinese Name | 2-苯基-3-(二甲氨基)丙烯醛 |
| Synonyms | 3-(Dimethylamino)-2-phenylacrolein; 3-dimethylamino-2-phenyl-acrylaldehyde; 3-dimethylamino-2-phenyl-propenal; 3-Dimethylamino-2-phenyl-acrylaldehyd; 2-Phenyl-3-(dimethylamino)acrolein |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.232 |
| Density | 1.022g/cm3 |
| Boiling Point | 394.5ºC at 760mmHg |
| HTC | 2922399090 |
| PubChem ID | 3191489 |
| MDL Number | MFCD01935969 |
| SMILES | CN(C)C=C(C=O)c1ccccc1 |
| InChI | InChI=1S/C11H13NO/c1-12(2)8-11(9-13)10-6-4-3-5-7-10/h3-9H,1-2H3/b11-8+ |
| InChI Key | ABQPNXRKOONAJA-DHZHZOJOSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6-fluoro-1,2,3,4-tetrahydroquinoxalin-2-one | 148010-65-5 | 2A-2189765 |
| N-[2-(AMINOMETHYL)PHENYL]-N,N-DIMETHYLAMINE | 57678-45-2 | 2A-2189773 |
| 3-AMino-1-Methylpyridin-2(1H)-one hydrochloride | 1523570-95-7 | 2A-2189774 |
| 1-(2-Brom-6-chlorphenyl)methanamin | 1261471-96-8 | 2A-2189776 |
| 4-CHLORO-2-FLUORO-6-METHYLANILINE | 939989-99-8 | 2A-2189777 |
| 1-(3-CHLORO-PHENYL)-CYCLOPROPYLAMINE | 474709-84-7 | 2A-2189784 |
| 3-BroMo-2,6-diMetylaniline | 53874-26-3 | 2A-2189787 |
| 3-amino-2-(methylamino)benzoic acid | 766491-67-2 | 2A-2189794 |
| 4-[(E)-2-[(E)-2-but-3-enoxyethenoxy]ethenoxy]but-1-ene: 1,2-diethenylb enzene: N-(3-dimethylaminopropyl)prop-2-enamide | 65899-87-8 | 2A-1189702 |
| 3-(3-AMINOPHENOXY)ANILINE | 15268-07-2 | 2A-2189798 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA