
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 100665-42-7 |
| Catalog No. | 2A-2189685 |
| Chinese Name | 灵芝烯酸C |
| Synonyms | (3β,5ξ,7β,15α,20Z,25R)-3,7,15-Trihydroxy-11,23-dioxolanosta-8,20(22)-dien-26-oic acid |
| Molecular Formula | C30H44O7 |
| Molecular Weight | 516.666 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 700.8±60.0 °C at 760 mmHg |
| Appearance | powder |
| Storage Condition | 2-8°C, sealed, dry |
| Application | Ganoderenic acid C is a triterpenoid isolated from Ganoderma lingzhi. Ganoderenic acid C is abundant in the early growth stages of Ganoderma lingzhi fruiting bodies. |
| PubChem ID | 85367724 |
| SMILES | CC(=CC(=O)CC(C)C(=O)O)C1CC(O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O)C(C)(C)C1CC3O |
| InChI | InChI=1S/C30H44O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h10,16,18-19,21-23,32,34-35H,8-9,11-14H2,1-7H3,(H,36,37)/b15-10-/t16?,18-,19+,21+,22+,23+,28+,29-,30+/m1/s1 |
| InChI Key | DIEUZIPSDUGWLD-KOXNGNSZSA-N |
| Transport Info | Product Name: Ganoderma Acid C |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| AESCIGENIN | 17806-68-7 | 2A-2189677 |
| Taccalonolide A | 108885-68-3 | 2A-2189679 |
| Mogroside II A2 | 88901-45-5 | 2A-2189680 |
| (10α,24R)-9β-Methyl-19-norlanosta-5-ene-3β,11α,24,25-tetrol | 88930-15-8 | 2A-2189681 |
| isoMogroside V | 1126032-65-2 | 2A-2189682 |
| Taccalonolide B | 108885-69-4 | 2A-2189689 |
| GANODERIC ACID C2(SH) | 98296-48-1 | 2A-2189691 |
| MOGROSIDE III | 130567-83-8 | 2A-2189694 |
| Mogroside ⅢA1 | 88901-42-2 | 2A-2189695 |
| solamargine | 20318-30-3 | 2A-2189696 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA