
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 113443-70-2 |
| Catalog No. | 2A-2189678 |
| Chinese Name | 大黄酸-8-葡萄糖苷钙盐 |
| Synonyms | Glucorein; Glucorhein; Rhein-8-glucoside calcium salt; Rhein-8-O-Beta-D-glucopyranoside; 8-Glucosylrhein |
| Molecular Formula | C21H16CaO11 |
| Molecular Weight | 446.36 |
| Boiling Point | 834.5ºC at 760mmHg |
| Storage Condition | 2-8℃ |
| Application | Rhein-8-glucoside calcium, an anthraquinone compound isolated from the EtOH extract of Saussurea lappa roots. Rhein-8-glucoside calcium is an hPTP1B inhibitor with an IC50 value of 11.5 μM. Rhein-8-gl |
| PubChem ID | 36416813 |
| MDL Number | MFCD29904549 |
| SMILES | O=C(O)c1cc([O-])c2c(c1)C(=O)c1c(C3OC(CO)C(O)C(O)C3O)ccc([O-])c1C2=O.[Ca+2] |
| InChI | InChI=1S/C21H18O11.Ca/c22-5-11-16(26)18(28)19(29)20(32-11)7-1-2-9(23)14-13(7)15(25)8-3-6(21(30)31)4-10(24)12(8)17(14)27;/h1-4,11,16,18-20,22-24,26,28-29H,5H2,(H,30,31);/q;+2/p-2/t11-,16-,18+,19-,20+;/m1./s1 |
| InChI Key | XXVBCAMVOFYHJP-UHFFFAOYSA-L |
| Beilstein/REAXYS | 1359724 |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| Transport Info | Product name: Rhein-8-O-β-D-glucoside |
| Related Products in Botanical Reference Standards | ||
|---|---|---|
| DisodiuM trans-crocetinate | 591230-99-8 | 2A-2189247 |
| NotoginsenosideFc | 88122-52-5 | 2A-2189671 |
| ginsenoside RG4 | 126223-28-7 | 2A-2189672 |
| Notoginsenoside Fa | 88100-04-3 | 2A-2189674 |
| escin IIa | 158732-55-9 | 2A-2189676 |
| GOMISING | 62956-48-3 | 2A-2189684 |
| Tigloylgomisin H | 66069-55-4 | 2A-2189686 |
| BAICALEIN 7-O-B-D-GLUCOPYRANOSIDE (BAICALIN) | 57396-78-8 | 2A-2189688 |
| gomisin D | 60546-10-3 | 2A-2189690 |
| gomisin J | 66280-25-9 | 2A-2189692 |
| Browse all Botanical Reference Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA