
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 39616-95-0 |
| Catalog No. | 2A-2189648 |
| Chinese Name | 4-氟-2-硝基苯乙酸 |
| Synonyms | Exact Mass 199.02800; PSA 83.12000; LogP 1.88420; InChIKey LAFOTQFKZXKMFD-UHFFFAOYSA-N |
| Molecular Formula | FC6H3(OCH3)B(OH)2 |
| Molecular Weight | 169.95 |
| Appearance | light brown to brown solid |
| Storage Condition | room temperature |
| HTC | 2916399090 |
| PubChem ID | 24880183 |
| MDL Number | MFCD03788423 |
| SMILES | O=C(O)Cc1ccc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H6FNO4/c9-6-2-1-5(3-8(11)12)7(4-6)10(13)14/h1-2,4H,3H2,(H,11,12) |
| InChI Key | LAFOTQFKZXKMFD-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352103 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| SulfaMide, N-[5-(4-broMophenyl)-6-chloro-4-pyriMidinyl]-N'-(phenylMethyl)- | 14101-58-7 | 2A-2189641 |
| VINYLACETIC ACID | 625-38-7 | 2A-2189642 |
| 3-Amino-N-[(1,1-Dimethylethoxy)Carbonyl]-D- Alanine Methyl Ester | 130622-06-9 | 2A-2189644 |
| 3-thietan-1-ol | 10304-16-2 | 2A-2189646 |
| ETHYL 3-BUTENOATE | 1617-18-1 | 2A-2189647 |
| 3,6-dichloropicolinonitrile | 1702-18-7 | 2A-2189650 |
| 2,2-DIMETHYL-1,3-PROPANEDIAMINE | 7328-91-8 | 2A-2189652 |
| 3,4-Dihydroxy-5-Nitrobenzoic Acid | 84211-30-3 | 2A-2189654 |
| N-tert-butyl-L-serineisopropyl ester | 955379-18-7 | 2A-2189656 |
| 6-BroMo-3-Methyl-2-pyridinaMine | 89466-16-0 | 2A-2189658 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA