
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 90458-75-6 |
| Catalog No. | 2A-2189639 |
| Chinese Name | 依茨舒二钠 |
| Synonyms | L55 A CVYTJ A1 A1 B1SWQ DU2R D2U- DL55 A CVYTJ A1 A1 B1SWQ &&2Na salt |
| Molecular Formula | C30H36Na2O8S2 |
| Molecular Weight | 634.712 |
| Storage Condition | 2-8°C, store in inert gas |
| Application | Ecamsule disodium is a broad spectrum UVA filter that can be used in sunscreen products. Ecamsule can reduce biological damage caused by solar radiation, such as pyrimidine dimer formation, p53 protei |
| PubChem ID | 354418517 |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)[O-])C(=O)C2=Cc1ccc(C=C2C(=O)C3(CS(=O)(=O)[O-])CCC2C3(C)C)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C28H34O8S2.2Na/c1-25(2)21-9-11-27(25,15-37(31,32)33)23(29)19(21)13-17-5-7-18(8-6-17)14-20-22-10-12-28(24(20)30,26(22,3)4)16-38(34,35)36;;/h5-8,13-14,21-22H,9-12,15-16H2,1-4H3,(H,31,32,33)(H,34,35,36);;/q;2*+1/p-2/b19-13-,20-14+;; |
| InChI Key | ABZNEHKRFLKURR-HPKCLRQXSA-L |
| Transport Info | Product name: Ecamsule.2Na |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Pentanone, 4-mercapto- (9CI) | 92585-08-5 | 2A-2189631 |
| FURFURYL ETHYL SULFIDE | 2024-70-6 | 2A-2189632 |
| 2-Methyl-1,3-oxathiolane-2-ethanethiol | 95792-16-8 | 2A-2189633 |
| N-(4-chlorobenzyl)-N-propylamine | 55245-43-7 | 2A-1189617 |
| Disperse Brown 27 | 94945-21-8 | 2A-2189638 |
| N-(chloracetyl)methanesulfonamide | 202658-88-6 | 2A-2189640 |
| SulfaMide, N-[5-(4-broMophenyl)-6-chloro-4-pyriMidinyl]-N'-(phenylMethyl)- | 14101-58-7 | 2A-2189641 |
| VINYLACETIC ACID | 625-38-7 | 2A-2189642 |
| 3-Amino-N-[(1,1-Dimethylethoxy)Carbonyl]-D- Alanine Methyl Ester | 130622-06-9 | 2A-2189644 |
| 3-thietan-1-ol | 10304-16-2 | 2A-2189646 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA