
CAS Number697-91-6
Synonyms2,6-dichloro-1,4-benzoquinone; 2,6-dichloro-p-benzoquinone; 2,6-dichloro-p-benzoquinone; 2,6-dichloro-p-benzoquinone; 2.6-dichloro-p-benzoquinone; 2,6-dichloro-p-benzoquinone
Molecular FormulaC6H2Cl2O2
Molecular Weight176.98
Density1.56g/cm3
Boiling Point241.5ºC at 760 mmHg
Melting Point122-124 °C(lit.)
AppearanceSolid;White to Amber powder to crystal
EINECS211-810-0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 697-91-6 |
| Catalog No. | 2A-2189624 |
| Chinese Name | 2、6一二氯-P-苯醌 |
| Synonyms | 2,6-dichloro-1,4-benzoquinone; 2,6-dichloro-p-benzoquinone; 2,6-dichloro-p-benzoquinone; 2,6-dichloro-p-benzoquinone; 2.6-dichloro-p-benzoquinone; 2,6-dichloro-p-benzoquinone |
| Molecular Formula | C6H2Cl2O2 |
| Molecular Weight | 176.98 |
| Density | 1.56g/cm3 |
| Boiling Point | 241.5ºC at 760 mmHg |
| Melting Point | 122-124 °C(lit.) |
| Appearance | Solid;White to Amber powder to crystal |
| Storage Condition | Store in an airtight container in a cool, dry plac |
| EINECS | 211-810-0 |
| HTC | 2914700090 |
| PubChem ID | 24867060 |
| MDL Number | MFCD00037159 |
| SMILES | O=C1C=C(Cl)C(=O)C(Cl)=C1 |
| InChI | InChI=1S/C6H2Cl2O2/c7-4-1-3(9)2-5(8)6(4)10/h1-2H |
| InChI Key | JCARTGJGWCGSSU-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-BroMo-N-phenylbenzenesulfonaMide | 166338-06-3 | 2A-2189616 |
| HYDROXYPROPYL METHACRYLATE | 923-26-2 | 2A-1189565 |
| diethyl 2-broMo-5-chloroterephthalate | 340148-60-9 | 2A-2189619 |
| ETHYLENE TRITHIOCARBONATE | 822-38-8 | 2A-2189620 |
| Trichloroethane | 25323-89-1 | 2A-2189621 |
| 4-Amino benzene sulfinic acid | 7472-15-3 | 2A-2189626 |
| Dihydro-2,4,6-trimethyl-4H-1,3,5-dithiazine | 94944-51-1 | 2A-2189629 |
| 2-Pentanone, 4-mercapto- (9CI) | 92585-08-5 | 2A-2189631 |
| FURFURYL ETHYL SULFIDE | 2024-70-6 | 2A-2189632 |
| 2-Methyl-1,3-oxathiolane-2-ethanethiol | 95792-16-8 | 2A-2189633 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA