
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 124728-45-6 |
| Catalog No. | 2A-2189282 |
| Chinese Name | 2,3-二氟-4-乙氧基苯甲酸 |
| Synonyms | 4-ethoxy-2,3-difluorobenzoic acid |
| Molecular Formula | C9H8O3F2 |
| Molecular Weight | 202.16 |
| Density | 1.339g/cm3 |
| Boiling Point | 282.2ºC at 760mmHg |
| Melting Point | 201-203ºC |
| Storage Condition | room temperature, dry |
| HTC | 2918990090 |
| PubChem ID | 3201349 |
| MDL Number | MFCD02258849 |
| SMILES | CCOc1ccc(C(=O)O)c(F)c1F |
| InChI | InChI=1S/C9H8F2O3/c1-2-14-6-4-3-5(9(12)13)7(10)8(6)11/h3-4H,2H2,1H3,(H,12,13) |
| InChI Key | KMFHBAZUQFJVKK-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| (4S)-(-)-T-BUTYLDIMETHYLSILOXY-2-CYCLOPENTEN-1-ONE | 61305-36-0 | 2A-1189273 |
| (4R)-(+)-T-BUTYLDIMETHYLSILOXY-2-CYCLOPENTEN-1-ONE | 61305-35-9 | 2A-1189276 |
| 4,4-Difluorocycloheptanone | 1227807-93-3 | 2A-2189278 |
| 4-Butyl-4'-propylbiphenyl | 79319-27-0 | 2A-2189279 |
| 4'-CHLORO-2'-FLUOROACETANILIDE | 59280-70-5 | 2A-2189281 |
| 2-Naphthalenamine,7-bromo-(9CI) | 590417-30-4 | 2A-1189278 |
| bredinin2',3',5'-tri-O-acetate (Mizoribine) | 55726-67-5 | 2A-2189287 |
| N-methyl-1-(4-(trifluoromethoxy)phenyl)methanamine hydrochloride | 1236000-51-3 | 2A-2189288 |
| 1-DIETHYLAMINO-3-BUTANONE | 3299-38-5 | 2A-2189295 |
| 7-broMo-4,4-diMethyl-3,4-dihydroquinolin-2(1H)-one | 185316-44-3 | 2A-2189296 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA