
CAS Number59042-49-8
Synonymscis-octahydro-1H-indene; cis-perhydroindonaphthene; cis-Hydrindan; cis-permethrin acid; cis-bicyclo<4.3.0>nonane; cis-perhydroindane; cis-permethrinic acid; cis-Perhydroindan-4-on-oxim; cis-Cypermethric acid; (1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid; (1S,3S)-3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid
Molecular FormulaC9H10O2Cl1F3
Molecular Weight242.63
Purity98.00%
Density1.433 g/cm3
Boiling Point290.6ºC at 760 mmHg
Melting Point83 - 85ºC
AppearanceAmorphous powder, white to off-white
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 59042-49-8 |
| Catalog No. | 2A-1189249 |
| Chinese Name | 顺式二氯菊酸 |
| Synonyms | cis-octahydro-1H-indene; cis-perhydroindonaphthene; cis-Hydrindan; cis-permethrin acid; cis-bicyclo<4.3.0>nonane; cis-perhydroindane; cis-permethrinic acid; cis-Perhydroindan-4-on-oxim; cis-Cypermethric acid; (1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid; (1S,3S)-3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid |
| Molecular Formula | C9H10O2Cl1F3 |
| Molecular Weight | 242.63 |
| Purity | 98.00 |
| Density | 1.433 g/cm3 |
| Boiling Point | 290.6ºC at 760 mmHg |
| Melting Point | 83 - 85ºC |
| Appearance | Amorphous powder, white to off-white |
| PubChem ID | 8177133 |
| MDL Number | MFCD09028017 |
| SMILES | CC1(C)[C@H](C=C(Cl)Cl)[C@@H]1C(O)=O |
| InChI | InChI=1S/C8H10Cl2O2/c1-8(2)4(3-5(9)10)6(8)7(11)12/h3-4,6H,1-2H3,(H,11,12)/t4-,6-/m1/s1 |
| InChI Key | InChIKey=LLMLSUSAKZVFOA-INEUFUBQSA-N |
| Transport Info | Product Name: Racemic-Permethrin |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 10-(3-(naphthalen-2-yl)phenyl)anthracene-9-boronic acid | 853945-54-7 | 2A-2189162 |
| 10-(3-(naphthalen-1-yl)phenyl)anthracene-9-boronic acid | 1084334-60-0 | 2A-2189163 |
| Spiro[indeno[2,1-b]carbazole-7(5H),9'-[9H]xanthene] | 1849673-24-0 | 2A-2189188 |
| Methyl 3-bromomethyl-4-cyanobenzoate | 908562-24-3 | 2A-2189206 |
| 1H-PYRROLO[2,3-B]PYRIDINE-6-BORONIC ACID | 1310383-09-5 | 2A-2189219 |
| 4-(Trifluoromethyl)phenylhydrazine hydrochloride | 2A-2189269 | 2A-2189269 |
| 3-cholro-4-ethoxy-2-fluoro benzaldehyde | 1823430-49-4 | 2A-2189280 |
| 4-CARBOXY-2,6-DIFLUOROBENZALDEHYDE | 736990-88-8 | 2A-2189283 |
| Trans-4-(3,4,5-trifluorophenyl) cyclohexanecarbaldehyde | 167161-17-3 | 2A-2189291 |
| 9h-carbazol-3ylboronic acid | 851524-97-5 | 2A-2189292 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA