CAS Number22976-40-5
Synonymsbis methyl ether of olivetol; Olivetol Dimethyl Ether; 1,3-Dimethoxy-5-pentyl-benzol; 1,3-Dimethoxy-5-pentylbenzene; Benzene, 1,3-dimethoxy-5-pentyl; dimethoxyolivetol; 3,5-Dimethoxyamylbenzene; Olivetol,O,O-dimethyl; 1,3-dimethoxy-5-pentyl-benzene; Benzene,1,3-dimethoxy-5-pentyl; Di-O-methylolivetol
Molecular FormulaC13H20O2
Molecular Weight208.3
Density0.9±0.1 g/cm3
Boiling Point296.8±20.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 22976-40-5 |
| Catalog No. | 2A-2189217 |
| Chinese Name | 1,3-Dimethoxy-5-pentylbenzene |
| Synonyms | bis methyl ether of olivetol; Olivetol Dimethyl Ether; 1,3-Dimethoxy-5-pentyl-benzol; 1,3-Dimethoxy-5-pentylbenzene; Benzene, 1,3-dimethoxy-5-pentyl; dimethoxyolivetol; 3,5-Dimethoxyamylbenzene; Olivetol,O,O-dimethyl; 1,3-dimethoxy-5-pentyl-benzene; Benzene,1,3-dimethoxy-5-pentyl; Di-O-methylolivetol |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.3 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 296.8±20.0 °C at 760 mmHg |
| HTC | 2909309090 |
| PubChem ID | 8672499 |
| MDL Number | C13H20O2 |
| SMILES | CCCCCc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C13H20O2/c1-4-5-6-7-11-8-12(14-2)10-13(9-11)15-3/h8-10H,4-7H2,1-3H3 |
| InChI Key | LSPSEUBXQFHRGA-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| CANNABINOL | 521-35-7 | 2A-2189211 |
| Cannabidivarol | 24274-48-4 | 2A-2189212 |
| cannabigerolic acid | 25555-57-1 | 2A-2189213 |
| 5-Propyl-1,3-benzenediol | 500-49-2 | 2A-2189215 |
| 5-butylbenzene-1,3-diol | 46113-76-2 | 2A-2189216 |
| Hydroxypinacolone Retinoate | 893412-73-2 | 2A-2189223 |
| 2-[2-oxopropyl]tetrahydro-2H-pyran-3,4,5-triol | 439685-73-1 | 2A-2189224 |
| PALMITOYL HYDROLYZED COLLAGEN | 68915-45-7 | 2A-2189225 |
| GPI choline | 425642-32-6 | 2A-2189226 |
| ETHYL LACTYL RETINOATEE | 74534-80-8 | 2A-2189227 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS