
CAS Number50597-19-8
Synonyms4-(3,4-Dichlor-phenyl)-4-oxo-buttersaeure; 4-(3,4-Dichlorophenyl)-4-oxobutyric acid; 4-(3,4-dichlorophenyl)-4-ketobutanoic acid; 4-(3',4'-dichlorophenyl)-4-oxo-butanoic acid; 3-(3,4-dichlorobenzoyl)-propionic acid
Molecular FormulaC10H8O3Cl2
Molecular Weight247.08
Density1.432g/cm3
Boiling Point447.1ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 50597-19-8 |
| Catalog No. | 2A-2189133 |
| Chinese Name | 4-(3,4-二氯苯基)-4-氧代丁酸 |
| Synonyms | 4-(3,4-Dichlor-phenyl)-4-oxo-buttersaeure; 4-(3,4-Dichlorophenyl)-4-oxobutyric acid; 4-(3,4-dichlorophenyl)-4-ketobutanoic acid; 4-(3',4'-dichlorophenyl)-4-oxo-butanoic acid; 3-(3,4-dichlorobenzoyl)-propionic acid |
| Molecular Formula | C10H8O3Cl2 |
| Molecular Weight | 247.08 |
| Density | 1.432g/cm3 |
| Boiling Point | 447.1ºC at 760mmHg |
| Storage Condition | room temperature |
| HTC | 2918300090 |
| PubChem ID | 432426 |
| MDL Number | MFCD01464149 |
| SMILES | OC(=O)CCC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H8Cl2O3/c11-7-2-1-6(5-8(7)12)9(13)3-4-10(14)15/h1-2,5H,3-4H2,(H,14,15) |
| InChI Key | InChIKey=DPCXOOJTAKKWIC-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ozenoxacin intermediate | 103877-38-9 | 2A-2189124 |
| CIS-3-HEXENYL ANTHRANILATE | 65405-76-7 | 2A-4189129 |
| 4-CHLORO-3,5-DINITRO-BENZOIC ACID ISOBUTYL ESTER | 58263-53-9 | 2A-2189130 |
| 2-NITROBENZAMIDE | 610-15-1 | 2A-2189131 |
| zinc 5-nitroisophthalate | 60580-61-2 | 2A-2189132 |
| PICFELTARRAENIN IB | 97230-46-1 | 2A-1189129 |
| 1-(3-chlorophenyl)propan-1-ol | 32019-30-0 | 2A-2189135 |
| KU-60019 | 925701-49-1 | 2A-1189136 |
| GNE140 | 2003234-63-5 | 2A-1189139 |
| PKC-theta inhibitor | 736048-65-0 | 2A-1189140 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA