
CAS Number3194-17-0
Synonyms2-Valerylfuran; 2-Pentanoylfuran; 1-(2-FURYL)PENTAN-1-ONE; 2-furyl n-butyl ketone; butyl 2-furyl ketone; 2-furyl butyl ketone; 1-furan-2-yl-pentan-1-one
Molecular FormulaC9H12O2
Molecular Weight152.19
Purity98.00%
Density0.992 g/cm3
Boiling Point224.8ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3194-17-0 |
| Catalog No. | 2A-1189067 |
| Chinese Name | 2-戊酰呋喃 |
| Synonyms | 2-Valerylfuran; 2-Pentanoylfuran; 1-(2-FURYL)PENTAN-1-ONE; 2-furyl n-butyl ketone; butyl 2-furyl ketone; 2-furyl butyl ketone; 1-furan-2-yl-pentan-1-one |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 |
| Purity | 98.00 |
| Density | 0.992 g/cm3 |
| Boiling Point | 224.8ºC at 760 mmHg |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2932190090 |
| PubChem ID | 87857 |
| MDL Number | MFCD00053147 |
| SMILES | CCCCC(=O)c1ccco1 |
| InChI | InChI=1S/C9H12O2/c1-2-3-5-8(10)9-6-4-7-11-9/h4,6-7H,2-3,5H2,1H3 |
| InChI Key | HTOZHTBIOGGHDJ-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12164502 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-MERCAPTO-3-METHYL-2-BUTANOL | 33959-27-2 | 2A-1189062 |
| (+/-)-N-LACTOYL TYRAMINE | 781674-18-8 | 2A-1189063 |
| (+/-)-2-MERCAPTOHEPTAN-4-OL | 1006684-20-3 | 2A-1189064 |
| 2-methylbutyl 3-methylbutenoate | 97890-13-6 | 2A-1189065 |
| 2-METHYLBUTYLAMINE | 96-15-1 | 2A-1189066 |
| (+/-)-CIS- AND TRANS-2-PENTYL-4-PROPYL-1,3-OXATHIANE | 59323-81-8 | 2A-1189068 |
| phenethyl decanoate | 61810-55-7 | 2A-1189069 |
| 2-PHENYL-4-METHYL-2-HEXENAL | 26643-92-5 | 2A-1189070 |
| 3-[(4-AMINO-2,2-DIOXIDO-1H-2,1,3-BENZOTHIADIAZIN-5-YL)OXY]-2,2-DIMETHYL-N-PROPYLPROPANAMIDE | 1093200-92-0 | 2A-1189072 |
| cis-4-(2,2,3-Trimethylcyclopentyl)butanoic acid | 957136-80-0 | 2A-1189073 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA