
CAS Number2754-17-8
SynonymsOxiranylmethyl hexanedioate; Bis(2,3-epoxypropyl) adipate; EINECS 220-403-7; adipic acid diglycidyl ester; diglycidyl adipate; Adipinsaeure-diglycidylester; hexanedioic acid bis-oxiranylmethyl ester
Molecular FormulaC12H18O6
Molecular Weight258.26800
Density1.24g/cm3
Boiling Point371.2ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2754-17-8 |
| Catalog No. | 2A-2189020 |
| Chinese Name | bis(2,3-epoxypropyl) adipate |
| Synonyms | Oxiranylmethyl hexanedioate; Bis(2,3-epoxypropyl) adipate; EINECS 220-403-7; adipic acid diglycidyl ester; diglycidyl adipate; Adipinsaeure-diglycidylester; hexanedioic acid bis-oxiranylmethyl ester |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.26800 |
| Density | 1.24g/cm3 |
| Boiling Point | 371.2ºC at 760mmHg |
| HTC | 2918990090 |
| PubChem ID | 43131701 |
| SMILES | O=C(CCCCC(=O)OCC1CO1)OCC1CO1 |
| InChI | InChI=1S/C12H18O6/c13-11(17-7-9-5-15-9)3-1-2-4-12(14)18-8-10-6-16-10/h9-10H,1-8H2 |
| InChI Key | KBWLNCUTNDKMPN-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Margatoxin | 145808-47-5 | 2A-1189013 |
| (+)-DISPARLURE | 54910-51-9 | 2A-1189015 |
| PHENOXY RESIN | 26402-79-9 | 2A-2189016 |
| 2-Propenoic acid, 2-[2-(ethenyloxy)ethoxy]ethyl ester | 86273-46-3 | 2A-2189017 |
| Cashew, nutshell liq., glycidyl ethers | 171263-25-5 | 2A-2189019 |
| Melamine Pyrophosphate | 15541-60-3 | 2A-2189021 |
| 2-methoxypropyl acetate | 70657-70-4 | 2A-2189022 |
| TETRABUTYLAMMONIUM L-LACTATE, 70 WT. % S OLUTION IN WATER | 178324-24-8 | 2A-1189024 |
| Avoparcin | 37332-99-3 | 2A-1189025 |
| Brominated SBS | 1195978-93-8 | 2A-2189027 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA