
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 38537-24-5 |
| Catalog No. | 2A-2188989 |
| Chinese Name | 咔唑-d8 |
| Synonyms | (1,2,3,4,5,6,7,8-H)-9H-Carbazole; carbazole d8; 9H-Carbazole-1,2,3,4,5,6,7,8-d; carbazole-d8,nh |
| Molecular Formula | C12HD8N |
| Molecular Weight | 175.26 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 355.0±11.0 °C at 760 mmHg |
| Storage Condition | room temperature |
| Application | Carbazole-d8 is deuterium labeled carbazole (HY-D0204). Carbazole is a tricyclic aromatic heterocycle. Carbazole can form a new type of DNA small groove complex to inhibit the synthesis of new DNA or |
| PubChem ID | 140683045 |
| MDL Number | MFCD00143920 |
| SMILES | c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C12H9N/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-8,13H/i1D,2D,3D,4D,5D,6D,7D,8D |
| InChI Key | UJOBWOGCFQCDNV-PGRXLJNUSA-N |
| UNSPSC | 12352116 |
| Transport Info | Product Name: Carbazole-d8 |
| Related Products in LED & Optoelectronic Materials | ||
|---|---|---|
| 9H-Carbazole, 9,9'-(9H-fluoren-9-ylidenedi-3,1-phenylene)bis | 1431945-64-0 | 2A-2188591 |
| 4-Bromo-5H-benzo[b]carbazole | 1686100-43-5 | 2A-2188742 |
| 9H-carbazole-3-carbonitrile | 57102-93-9 | 2A-2188897 |
| 9-(4,6-Diphenyl-1,3,5-triazin-2-yl)-9'-phenyl-3,3'-dicarbazole | 1266389-01-8 | 2A-2188967 |
| 9-(biphenyl-4-yl)-3-boric acid-9H-carbazole | 1028648-22-7 | 2A-2188974 |
| 9-(4-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)naphthalen-1-yl)-9H-carbazole | 2376616-77-0 | 2A-2189002 |
| 3-bromo-9-(dibenzo[b,d]furan-3-yl)-9H-carbazole | 1613325-84-0 | 2A-2189007 |
| 3-bromo-9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9H-Carbazole | 1266389-19-8 | 2A-2189173 |
| 4CzIPN-Ph | 1469705-37-0 | 2A-1190121 |
| 4CzIPN-Bu | 1630263-99-8 | 2A-1190126 |
| Browse all LED & Optoelectronic Materials products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA