
CAS Number119-26-6
SynonymsDINITROPHENYL HYDRAZINE; DNPH; (2,4-dinitro-phenyl)-hydrazine; 2,4-Dinitrophenylhydrazine (contains HCl) Ethanol; DNP; Dinitrophenylhydrzine; MFCD00007578; (2,4-Dinitrophenyl)hydrazine; DINITROPHENYL HYDRAZ; EINECS 204-309-3; 2,4-DNPH; Brady's reagent; 2,4-DIBROMO-5-METHYLBENZOTRIFLUORIDE; 2,4-Dinitrophenylhydrazine; Dnp-hydrazine; 2,4-Dinitrofenylhydrazin
Molecular Formula(O2N)2C6H3NHNH2
Molecular Weight198.14
Purity97%
Density1.7±0.1 g/cm3
Boiling Point378.6±32.0 °C at 760 mmHg
Melting Point197-200 °C (lit.)
Appearancered powder
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 119-26-6 |
| Catalog No. | 2A-9019029 |
| Chinese Name | 2,4-二硝基苯肼 |
| Synonyms | DINITROPHENYL HYDRAZINE; DNPH; (2,4-dinitro-phenyl)-hydrazine; 2,4-Dinitrophenylhydrazine (contains HCl) Ethanol; DNP; Dinitrophenylhydrzine; MFCD00007578; (2,4-Dinitrophenyl)hydrazine; DINITROPHENYL HYDRAZ; EINECS 204-309-3; 2,4-DNPH; Brady's reagent; 2,4-DIBROMO-5-METHYLBENZOTRIFLUORIDE; 2,4-Dinitrophenylhydrazine; Dnp-hydrazine; 2,4-Dinitrofenylhydrazin |
| Molecular Formula | (O2N)2C6H3NHNH2 |
| Molecular Weight | 198.14 |
| Purity | 97 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 378.6±32.0 °C at 760 mmHg |
| Melting Point | 197-200 °C (lit.) |
| Appearance | red powder |
| Water Solubility | slightly soluble |
| Storage Condition | Storage precautions: For safety reasons, always mo |
| Packaging | II |
| HTC | 2928000090 |
| PubChem ID | 24893586 |
| MDL Number | MFCD00007578 |
| SMILES | NNc1ccc(cc1[N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C6H6N4O4/c7-8-5-2-1-4(9(11)12)3-6(5)10(13)14/h1-3,8H,7H2 |
| InChI Key | HORQAOAYAYGIBM-UHFFFAOYSA-N |
| Beilstein/REAXYS | 615586 |
| NACRES Code | NA.21 |
| UNSPSC | 12352100 |
| Hazard Symbols | 4.1 |
| MSDS | msds/19029_1_119_26_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 1,2,4,5-Tetrachlorobenzene | 95-94-3 | 2A-9017941 |
| 2,4,5-Trichlorophenol | 95-95-4 | 2A-9017942 |
| 2,4-Dinitroaniline | 97-02-9 | 2A-9017998 |
| Furfuryl mercaptan | 98-02-2 | 2A-9018040 |
| Benzyl mercaptan | 100-53-8 | 2A-9018208 |
| 2,4-Dinitroanisole | 119-27-7 | 2A-9019030 |
| 2,4-Di-tert-pentylphenol | 120-95-6 | 2A-9019103 |
| 2,4-Dinitrotoluene | 121-14-2 | 2A-9019110 |
| 2,4-Dihydroxybenzophenone | 131-56-6 | 2A-9020674 |
| Folpet | 133-07-3 | 2A-9020699 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA