
CAS Number23008-56-2
SynonymsMFCD02683544; N-(4-Chlorophenyl)-2-nitroaniline; 4-Chloro-2'-nitrodiphenylamine; N-(4-Chlorophenyl)-2-nitrobenzenamine; EINECS 245-377-4
Molecular FormulaC12H9ClN2O2
Molecular Weight247.68
Density1.4±0.1 g/cm3
Boiling Point377.2±27.0 °C at 760 mmHg
Melting Point145-148 °C(lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 23008-56-2 |
| Catalog No. | 2A-2188785 |
| Chinese Name | 4-氯-2'-硝基联苯胺 |
| Synonyms | MFCD02683544; N-(4-Chlorophenyl)-2-nitroaniline; 4-Chloro-2'-nitrodiphenylamine; N-(4-Chlorophenyl)-2-nitrobenzenamine; EINECS 245-377-4 |
| Molecular Formula | C12H9ClN2O2 |
| Molecular Weight | 247.68 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 377.2±27.0 °C at 760 mmHg |
| Melting Point | 145-148 °C(lit.) |
| Storage Condition | Store in an airtight, cool and dry place, ensuring |
| HTC | 2921440000 |
| PubChem ID | 329819078 |
| MDL Number | MFCD00563301 |
| SMILES | O=[N+]([O-])c1ccccc1Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H9ClN2O2/c13-9-5-7-10(8-6-9)14-11-3-1-2-4-12(11)15(16)17/h1-8,14H |
| InChI Key | RCLKXSIRDRWUGX-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| Tax Rebate | 17.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2921440000. diphenylamine and its derivatives; salts thereof. VAT:17.0%. Tax rebate rate:17.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-phenylnaphthalen-1-ol | 30069-65-9 | 2A-2188779 |
| HEXYL 4-HYDROXYBENZOATE | 1083-27-8 | 2A-2188780 |
| 4-HYDROXYBENZOIC ACID N-NONYL ESTER | 38713-56-3 | 2A-2188781 |
| 1-Hydroxy-4-phenylnaphthaline | 36159-76-9 | 2A-2188783 |
| 2-morpholinoacetamidine | 14890-25-6 | 2A-2188784 |
| 1-tert-Butyl-3,5-dimethylbenzene | 98-19-1 | 2A-2188786 |
| methyl phenothiazin-10-yl ketone | 1628-29-1 | 2A-2188787 |
| N-n-butyl diisopropanol amine | 4402-34-0 | 2A-2188789 |
| N-METHYL-2,2'-DIAMINODIETHYLAMINE | 4097-88-5 | 2A-2188791 |
| 3-METHYL-2-OXAZOLIDONE | 19836-78-3 | 2A-2188792 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA