
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3164-13-4 |
| Catalog No. | 2A-2188534 |
| Chinese Name | 2-(4-溴苯基)苯并恶唑 |
| Synonyms | MFCD00168898 |
| Molecular Formula | C13H8BrNO |
| Molecular Weight | 274.12 |
| Density | 1.514g/cm3 |
| Boiling Point | 339.1ºC at 760 mmHg |
| Melting Point | 161 °C |
| Appearance | Solid;White to Orange to Green powder to crystal |
| Water Solubility | Soluble in: Toluene |
| Storage Condition | room temperature, dry |
| HTC | 2934999090 |
| PubChem ID | 41874838 |
| SMILES | Brc1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C13H8BrNO/c14-10-7-5-9(6-8-10)13-15-11-3-1-2-4-12(11)16-13/h1-8H |
| InChI Key | RBVHJNZMSBQFDK-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1H-Pyrrole-3-butanoic acid, 4-(ethoxycarbonyl)- | 1391938-52-5 | 2A-2188503 |
| Indoline-2-carboxylic Acid Ethyl Ester | 50501-07-0 | 2A-2188512 |
| 3-Chloro-6-(3-trifluoromethyl-phenyl)-pyridazine | 66548-63-8 | 2A-2188514 |
| 2-(3-bromophenyl)-1,3-benzoxazole | 99586-31-9 | 2A-2188532 |
| 5-BROMO-2-PHENYL-1,3-BENZOXAZOLE | 69918-19-0 | 2A-2188533 |
| 2-chloro-4,6-di-p-tolyl-1,3,5-triazine | 21902-34-1 | 2A-2188539 |
| 4-(biphenyl-4-yl)-2,6-dichloropyrimidine | 1385826-81-2 | 2A-2188549 |
| N-phenyldibenzo[b,d]furan-4-amine | 743453-07-8 | 2A-2188562 |
| 2-Chloro-4-dibenzofuran-4-yl-6-phenyl-[1,3,5]triazine | 1472729-25-1 | 2A-2188567 |
| 2-(4-Biphenylyl)-4,6-dichloro-1,3,5-triazine | 10202-45-6 | 2A-2188568 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA