
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 9000-92-4 |
| Catalog No. | 2A-2188389 |
| Chinese Name | 淀粉酶 |
| Synonyms | MFCD00081555; diastase; malt diastase; diastase (aspergillus oryzae); maltin; diastase (ex malt); diastase of malt; malt; diastase (malt); Amylase |
| Molecular Formula | C11H10FNO |
| Molecular Weight | 191.20 |
| Appearance | powder | white |
| Storage Condition | Store in a cool, dark place at 2-8°C, away from mo |
| Application | Amylase is an enzyme secreted by the pancreas and salivary glands that hydrolyzes starch. |
| EINECS | 232-567-7 |
| PubChem ID | 87567676 |
| MDL Number | MFCD00081555 |
| InChI | InChI=1S/C11H10FNO/c1-2-3-8-13-11(14)9-4-6-10(12)7-5-9/h3-7H,1,8H2,(H,13,14) |
| InChI Key | YMXBQIIPWIMAQE-UHFFFAOYSA-N |
| NACRES Code | NA.54 |
| UNSPSC | 12352204 |
| Transport Info | Product name: Amylase (Aspergillus oryzae) |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| ethyl 2-bromo-6-(tert-butyl)-3-methoxyisonicotinate | 868047-76-1 | 2A-2188350 |
| ethyl 2-bromo-6-(tert-butyl)-3-hydroxyisonicotinate | 868047-75-0 | 2A-2188351 |
| ethyl 2-(tert-butyl)-5-hydroxyisonicotinate | 868047-74-9 | 2A-2188352 |
| 6,6-dimethylcyclohex-2-en-1-one | 6553-64-6 | 2A-1188387 |
| 2-METHYL-1,3-PENTADIENE | 1118-58-7 | 2A-4188388 |
| Cediranib Maleate | 857036-77-2 | 2A-2188394 |
| ANGIOTENSIN I, HUMAN | 484-42-4 | 2A-2188396 |
| DOWFAX™ 8390 Solution Surfactant | 65143-89-7 | 2A-4188399 |
| 3-(hydroxymethyl)-3-nitro-1-(4-octylphenyl)-Ben | 899822-99-2 | 2A-2188400 |
| 2-fluoro-N-Methyl BenzeneethanaMine HCL | 1067237-58-4 | 2A-2188403 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA